3-(6-amino-1-(4,4,4-trifluorobutyl)-1H-indol-3-yl)-4-fluorobenzothioamide

ID: ALA4549252

PubChem CID: 132137240

Max Phase: Preclinical

Molecular Formula: C19H17F4N3S

Molecular Weight: 395.43

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC(=S)c1ccc(F)c(-c2cn(CCCC(F)(F)F)c3cc(N)ccc23)c1

Standard InChI:  InChI=1S/C19H17F4N3S/c20-16-5-2-11(18(25)27)8-14(16)15-10-26(7-1-6-19(21,22)23)17-9-12(24)3-4-13(15)17/h2-5,8-10H,1,6-7,24H2,(H2,25,27)

Standard InChI Key:  LZFRHIJUZGINGN-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 29  0  0  0  0  0  0  0  0999 V2000
   13.0035   -4.1850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0354   -5.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7640   -5.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4531   -4.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8051   -6.2059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1380   -6.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4027   -7.4597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4684   -6.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2169   -7.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7647   -8.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2633   -6.5121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8128   -7.1154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5579   -7.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1053   -8.4960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9278   -8.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7003   -3.7431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4136   -4.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0993   -3.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8200   -4.0843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0726   -2.8823    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   12.1163   -8.0427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6387   -8.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8256   -8.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3480   -9.2867    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.4902   -7.8785    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.0044   -8.6177    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.3440   -5.4361    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4 17  1  0
 16  1  1  0
  3  5  1  0
  5  6  2  0
  6  7  1  0
  7  9  1  0
  8  5  1  0
  8  9  2  0
  9 10  1  0
 10 13  2  0
 12 11  2  0
 11  8  1  0
 12 13  1  0
 13 14  1  0
  7 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 15 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
  2 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549252

    ---

Associated Targets(Human)

ASH1L Tbio Histone-lysine N-methyltransferase ASH1L (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 395.43Molecular Weight (Monoisotopic): 395.1079AlogP: 5.01#Rotatable Bonds: 5
Polar Surface Area: 56.97Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.60CX Basic pKa: 3.37CX LogP: 4.51CX LogD: 4.51
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.36Np Likeness Score: -1.24

References

1.  (2017)  Ash1l inhibitors and methods of treatment therewith, 

Source