The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(((6-(Aminomethyl)pyrimidin-4-yl)(methyl)amino)methyl)-N-phenylbenzamide hydrochloride ID: ALA4549270
PubChem CID: 135186009
Max Phase: Preclinical
Molecular Formula: C20H22ClN5O
Molecular Weight: 347.42
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1cccc(C(=O)Nc2ccccc2)c1)c1cc(CN)ncn1.Cl
Standard InChI: InChI=1S/C20H21N5O.ClH/c1-25(19-11-18(12-21)22-14-23-19)13-15-6-5-7-16(10-15)20(26)24-17-8-3-2-4-9-17;/h2-11,14H,12-13,21H2,1H3,(H,24,26);1H
Standard InChI Key: ONBXPBROBYJOLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
29.1402 -6.3938 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
24.8704 -8.9838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1770 -8.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2009 -7.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5075 -7.2696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7505 -7.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7131 -8.4837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4201 -8.9449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5314 -6.4258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8380 -5.9906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.0810 -6.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8618 -5.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1684 -4.7116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1923 -3.8678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.9232 -3.4852 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.6302 -3.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5927 -4.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3872 -3.5502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4110 -2.7064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.6013 -8.6013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.8466 -9.8277 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.5536 -10.2890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5161 -11.1067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2231 -11.5680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9540 -11.1855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9778 -10.3416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2845 -9.9064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
5 9 1 0
9 10 1 0
10 11 1 0
10 12 1 0
13 12 2 0
14 13 1 0
14 15 2 0
16 15 1 0
17 16 2 0
12 17 1 0
16 18 1 0
18 19 1 0
2 20 2 0
2 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 347.42Molecular Weight (Monoisotopic): 347.1746AlogP: 2.82#Rotatable Bonds: 6Polar Surface Area: 84.14Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.20CX LogP: 2.78CX LogD: 1.91Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.72Np Likeness Score: -1.63
References 1. (2018) Lysyl oxidase-like 2 inhibitors and uses thereof,