The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,5-dichloro-2-(4-chloro-2-(3-(3,4-dichlorophenyl)ureido)phenoxy)benzenesulfonate ID: ALA4549336
PubChem CID: 155550401
Max Phase: Preclinical
Molecular Formula: C19H11Cl5N2O5S
Molecular Weight: 556.64
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(Cl)c(Cl)c1)Nc1cc(Cl)ccc1Oc1cc(Cl)c(Cl)cc1S(=O)(=O)O
Standard InChI: InChI=1S/C19H11Cl5N2O5S/c20-9-1-4-16(31-17-7-13(23)14(24)8-18(17)32(28,29)30)15(5-9)26-19(27)25-10-2-3-11(21)12(22)6-10/h1-8H,(H2,25,26,27)(H,28,29,30)
Standard InChI Key: JHTYLLPZYIYIOH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
9.8678 -22.2525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4594 -21.5398 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
9.0464 -22.2498 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4658 -17.8353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4645 -18.6627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1795 -19.0757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8960 -18.6623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8931 -17.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1777 -17.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6112 -19.0736 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3250 -18.6600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0403 -19.0714 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.3238 -17.8350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1752 -16.5974 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.7511 -17.4229 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
8.7542 -18.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4681 -19.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1815 -18.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1807 -17.8316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4604 -17.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7500 -17.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4562 -16.5953 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
9.4683 -19.8956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1829 -20.3081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1778 -21.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8915 -21.5449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6069 -21.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6041 -20.3027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8897 -19.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7487 -21.1279 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3171 -19.8875 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
12.3222 -21.5435 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
4 15 1 0
12 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
20 22 1 0
17 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
25 2 1 0
2 30 1 0
28 31 1 0
27 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 556.64Molecular Weight (Monoisotopic): 553.8831AlogP: 7.64#Rotatable Bonds: 5Polar Surface Area: 104.73Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: -2.92CX Basic pKa: ┄CX LogP: 4.53CX LogD: 4.44Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -1.48
References 1. Bobrovs R, Jaudzems K, Jirgensons A.. (2019) Exploiting Structural Dynamics To Design Open-Flap Inhibitors of Malarial Aspartic Proteases., 62 (20): [PMID:31062983 ] [10.1021/acs.jmedchem.9b00184 ]