1alpha,6beta,9beta-Trihydroxy-5,10-bis-epi-eudesm-3-ene-6-O-beta-D-glucopyranoside

ID: ALA4549381

PubChem CID: 155550665

Max Phase: Preclinical

Molecular Formula: C21H36O8

Molecular Weight: 416.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=CC[C@H](O)[C@@]2(C)[C@@H](O)C[C@@H](C(C)C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H]12

Standard InChI:  InChI=1S/C21H36O8/c1-9(2)11-7-14(24)21(4)13(23)6-5-10(3)15(21)19(11)29-20-18(27)17(26)16(25)12(8-22)28-20/h5,9,11-20,22-27H,6-8H2,1-4H3/t11-,12+,13-,14-,15-,16+,17-,18+,19+,20-,21-/m0/s1

Standard InChI Key:  HUQZKJPWNKJYME-WSRXGMRJSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   25.0544   -7.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4552   -7.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2723   -7.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.6927   -7.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2879   -6.3694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4667   -6.3556    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.2331   -7.0586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8262   -6.3435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7104   -5.6633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.5140   -7.0959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.6772   -8.5045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.0398   -8.4894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.5942   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5942   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3036   -4.8371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3036   -3.1945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0130   -3.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0095   -4.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7157   -4.8420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4298   -4.4386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4333   -3.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7226   -3.1993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3044   -5.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3036   -2.3732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0015   -5.2498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.0057   -2.7900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1352   -4.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1306   -5.6725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8494   -4.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7250   -2.3780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.6837   -6.9379    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  7  1  1
  7  8  1  0
  5  9  1  0
  4 10  1  6
  3 11  1  1
  2 12  1  6
 13 14  1  0
 13 16  1  0
 14 15  2  0
 15 18  1  0
 17 16  1  0
 17 18  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 15 23  1  0
 16 24  1  6
 18 25  1  1
 17 26  1  6
 19  9  1  1
 20 27  1  1
 27 28  1  0
 27 29  1  0
 22 30  1  1
  5 31  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4549381

    ---

Associated Targets(non-human)

HT-22 (3261 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 416.51Molecular Weight (Monoisotopic): 416.2410AlogP: -0.46#Rotatable Bonds: 4
Polar Surface Area: 139.84Molecular Species: NEUTRALHBA: 8HBD: 6
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.21CX Basic pKa: CX LogP: -0.60CX LogD: -0.60
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.34Np Likeness Score: 2.75

References

1. An JP, Ha TKQ, Kim HW, Ryu B, Kim J, Park J, Lee CH, Oh WK..  (2019)  Eudesmane Glycosides from Ambrosia artemisiifolia (Common Ragweed) as Potential Neuroprotective Agents.,  82  (5): [PMID:31009220] [10.1021/acs.jnatprod.8b00841]

Source