(4Z,7Z,10Z,13Z,16Z,19Z)-N-(Pentafluoroethanesulfonyl)docosa-4,7,10,13,16,19-hexaenamide

ID: ALA4549389

PubChem CID: 155550724

Max Phase: Preclinical

Molecular Formula: C24H32F5NO3S

Molecular Weight: 509.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NS(=O)(=O)C(F)(F)C(F)(F)F

Standard InChI:  InChI=1S/C24H32F5NO3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(31)30-34(32,33)24(28,29)23(25,26)27/h3-4,6-7,9-10,12-13,15-16,18-19H,2,5,8,11,14,17,20-21H2,1H3,(H,30,31)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-

Standard InChI Key:  XDUWZJDHGPVBIL-KUBAVDMBSA-N

Molfile:  

 
     RDKit          2D

 34 33  0  0  0  0  0  0  0  0999 V2000
   12.2314   -4.8172    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9554   -7.6838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9209   -5.9297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8157   -4.0019    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.7798   -5.2284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8349   -8.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5404   -8.4990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7843   -7.6786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9569   -8.5006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9418   -6.0506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3693   -8.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4883   -6.4522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1040   -4.4088    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.0729   -4.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2498   -9.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5386  -10.1357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6638   -8.9075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0805   -8.9049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5167   -5.2255    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.6521   -4.8172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3583   -5.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7813   -6.0451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8148   -4.8187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9418   -5.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2484   -7.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5389   -7.6823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4898   -7.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7859   -8.4953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8333   -9.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1079   -5.9271    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1082   -5.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1080   -6.0435    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.4006   -4.8175    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.3977   -5.6295    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 24 10  2  0
  6 29  2  0
  1 19  1  0
 24 20  1  0
 23 13  1  0
 23  4  1  0
 16 15  1  0
  2 25  1  0
 27  8  1  0
  5 22  1  0
 11 17  1  0
 17  9  2  0
 19  3  2  0
 18 11  1  0
 29 16  1  0
 19 23  1  0
 30 19  2  0
 12 27  2  0
 22 12  1  0
 24  1  1  0
  7  6  1  0
 14  5  2  0
 20 21  1  0
 21 14  1  0
 23 31  1  0
 25 26  2  0
 28 18  2  0
  8 28  1  0
  9  2  1  0
 26  7  1  0
 31 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549389

    ---

Associated Targets(non-human)

RBL-2H3 (1162 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 509.58Molecular Weight (Monoisotopic): 509.2023AlogP: 7.07#Rotatable Bonds: 16
Polar Surface Area: 63.24Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.31CX Basic pKa: CX LogP: 7.62CX LogD: 6.67
Aromatic Rings: Heavy Atoms: 34QED Weighted: 0.18Np Likeness Score: 0.33

References

1. Kim IH, Kanayama Y, Nishiwaki H, Sugahara T, Nishi K..  (2019)  Structure-Activity Relationships of Fish Oil Derivatives with Antiallergic Activity in Vitro and in Vivo.,  62  (21): [PMID:31618024] [10.1021/acs.jmedchem.9b00994]

Source