5-((5-(2-bromo-4-methylphenyl)furan-2-yl)methylene)pyrimidine-2,4,6(1H,3H,5H)-trione

ID: ALA4549399

PubChem CID: 1369989

Max Phase: Preclinical

Molecular Formula: C16H11BrN2O4

Molecular Weight: 375.18

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2ccc(C=C3C(=O)NC(=O)NC3=O)o2)c(Br)c1

Standard InChI:  InChI=1S/C16H11BrN2O4/c1-8-2-4-10(12(17)6-8)13-5-3-9(23-13)7-11-14(20)18-16(22)19-15(11)21/h2-7H,1H3,(H2,18,19,20,21,22)

Standard InChI Key:  IVMPSQAPIZZBLP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   13.4585   -8.9710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4585   -9.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1706  -10.2044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8826   -9.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8826   -8.9710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1706   -8.5543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1706   -7.7293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7447  -10.2095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5965  -10.2095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7428   -8.5606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7405   -7.7356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4027   -7.2486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1455   -6.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3203   -6.4671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0678   -7.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6284   -5.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4460   -5.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9288   -5.2131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5911   -4.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7657   -4.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2866   -5.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0731   -3.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4655   -4.9671    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  2  8  2  0
  4  9  2  0
  1 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  2  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 19 22  1  0
 21 23  1  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 375.18Molecular Weight (Monoisotopic): 373.9902AlogP: 2.77#Rotatable Bonds: 2
Polar Surface Area: 88.41Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.97CX Basic pKa: CX LogP: 2.69CX LogD: 2.14
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.62Np Likeness Score: -0.98

References

1.  (2012)  Entpd5 inhibitors, 

Source