4-((5-methoxy-1H-benzo[d]imidazol-2-yl)methylamino)benzimidamide

ID: ALA4549483

PubChem CID: 155550727

Max Phase: Preclinical

Molecular Formula: C16H17N5O

Molecular Weight: 295.35

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2[nH]c(CNc3ccc(C(=N)N)cc3)nc2c1

Standard InChI:  InChI=1S/C16H17N5O/c1-22-12-6-7-13-14(8-12)21-15(20-13)9-19-11-4-2-10(3-5-11)16(17)18/h2-8,19H,9H2,1H3,(H3,17,18)(H,20,21)

Standard InChI Key:  RZADLVZIZRFESU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   21.3840   -1.8026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0243   -1.8089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6117   -1.0948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7934   -1.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6111   -2.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7943   -2.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5361   -3.2878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1935   -3.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8578   -3.2975    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1874   -4.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9007   -5.0187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8947   -5.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1752   -6.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1688   -7.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8826   -7.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6043   -7.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6071   -6.2607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8777   -8.3256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1589   -8.7348    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.5915   -8.7434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.0249   -0.3783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.8520   -0.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  6  2  0
  5  2  2  0
  2  3  1  0
  3  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 15 18  1  0
 18 19  2  0
 18 20  1  0
  3 21  1  0
 21 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549483

    ---

Associated Targets(Human)

KLK5 Tchem Kallikrein 5 (307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
KLK1 Tchem Kallikrein 1 (594 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 295.35Molecular Weight (Monoisotopic): 295.1433AlogP: 2.47#Rotatable Bonds: 5
Polar Surface Area: 99.81Molecular Species: BASEHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 11.73CX Basic pKa: 12.60CX LogP: 0.33CX LogD: -1.13
Aromatic Rings: 3Heavy Atoms: 22QED Weighted: 0.43Np Likeness Score: -1.21

References

1. Walker AL, Bingham RP, Edgar EV, Ferrie A, Holmes DS, Liddle J, Polyakova O, Rella M, Smith KJ, Thorpe JH, Wang Y, White GV, Young RJ, Hovnanian A..  (2019)  Structure guided drug design to develop kallikrein 5 inhibitors to treat Netherton syndrome.,  29  (12): [PMID:31005442] [10.1016/j.bmcl.2019.04.022]

Source