The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-7-(but-2-en-1-yl)-5-(3-fluoro-4-(4-(methylsulfonyl)piperazine-1-carbonyl)phenyl)imidazo[1,5-a]pyrazin-8(7H)-one ID: ALA4549494
PubChem CID: 155550768
Max Phase: Preclinical
Molecular Formula: C22H24FN5O4S
Molecular Weight: 473.53
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/Cn1cc(-c2ccc(C(=O)N3CCN(S(C)(=O)=O)CC3)c(F)c2)n2cncc2c1=O
Standard InChI: InChI=1S/C22H24FN5O4S/c1-3-4-7-26-14-20(28-15-24-13-19(28)22(26)30)16-5-6-17(18(23)12-16)21(29)25-8-10-27(11-9-25)33(2,31)32/h3-6,12-15H,7-11H2,1-2H3/b4-3+
Standard InChI Key: FJIJVRLXFGUCPZ-ONEGZZNKSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
8.5805 -24.6519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1760 -23.9462 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7671 -24.6493 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6473 -17.8255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6473 -18.6427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3525 -19.0472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3525 -17.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3521 -19.8635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6428 -20.2715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6424 -21.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3507 -21.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0607 -21.0844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0576 -20.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0578 -17.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0578 -18.6437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8359 -18.8966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3170 -18.2347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8360 -17.5728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3525 -16.5956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9384 -17.4190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3517 -22.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6446 -22.7241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0600 -22.7222 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0578 -23.5384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7620 -23.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4715 -23.5399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4724 -22.7217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7637 -22.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2318 -17.8296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5229 -17.4231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8164 -17.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8869 -23.5433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7699 -21.4905 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
4 7 1 0
5 6 2 0
6 15 1 0
14 7 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 8 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 2 0
7 19 2 0
4 20 1 0
11 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
20 29 1 0
29 30 2 0
30 31 1 0
26 2 1 0
2 32 1 0
12 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.53Molecular Weight (Monoisotopic): 473.1533AlogP: 1.60#Rotatable Bonds: 5Polar Surface Area: 96.99Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.90CX LogP: -0.09CX LogD: -0.09Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.46
References 1. Zheng P, Zhang J, Ma H, Yuan X, Chen P, Zhou J, Zhang H.. (2019) Design, synthesis and biological evaluation of imidazo[1,5-a]pyrazin-8(7H)-one derivatives as BRD9 inhibitors., 27 (7): [PMID:30824168 ] [10.1016/j.bmc.2019.02.045 ]