(E)-7-(but-2-en-1-yl)-5-(3-fluoro-4-(4-(methylsulfonyl)piperazine-1-carbonyl)phenyl)imidazo[1,5-a]pyrazin-8(7H)-one

ID: ALA4549494

PubChem CID: 155550768

Max Phase: Preclinical

Molecular Formula: C22H24FN5O4S

Molecular Weight: 473.53

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C/C=C/Cn1cc(-c2ccc(C(=O)N3CCN(S(C)(=O)=O)CC3)c(F)c2)n2cncc2c1=O

Standard InChI:  InChI=1S/C22H24FN5O4S/c1-3-4-7-26-14-20(28-15-24-13-19(28)22(26)30)16-5-6-17(18(23)12-16)21(29)25-8-10-27(11-9-25)33(2,31)32/h3-6,12-15H,7-11H2,1-2H3/b4-3+

Standard InChI Key:  FJIJVRLXFGUCPZ-ONEGZZNKSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    8.5805  -24.6519    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1760  -23.9462    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.7671  -24.6493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6473  -17.8255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6473  -18.6427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -19.0472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -17.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3521  -19.8635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6428  -20.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6424  -21.0879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3507  -21.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0607  -21.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0576  -20.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0578  -17.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0578  -18.6437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8359  -18.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3170  -18.2347    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8360  -17.5728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3525  -16.5956    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9384  -17.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3517  -22.3145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6446  -22.7241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0600  -22.7222    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0578  -23.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7620  -23.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4715  -23.5399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4724  -22.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7637  -22.3096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2318  -17.8296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5229  -17.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8164  -17.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8869  -23.5433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7699  -21.4905    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  4  7  1  0
  5  6  2  0
  6 15  1  0
 14  7  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  6  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  2  0
  7 19  2  0
  4 20  1  0
 11 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 23 28  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 20 29  1  0
 29 30  2  0
 30 31  1  0
 26  2  1  0
  2 32  1  0
 12 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549494

    ---

Associated Targets(Human)

BRD9 Tchem Bromodomain-containing protein 9 (684 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.53Molecular Weight (Monoisotopic): 473.1533AlogP: 1.60#Rotatable Bonds: 5
Polar Surface Area: 96.99Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 1.90CX LogP: -0.09CX LogD: -0.09
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.52Np Likeness Score: -1.46

References

1. Zheng P, Zhang J, Ma H, Yuan X, Chen P, Zhou J, Zhang H..  (2019)  Design, synthesis and biological evaluation of imidazo[1,5-a]pyrazin-8(7H)-one derivatives as BRD9 inhibitors.,  27  (7): [PMID:30824168] [10.1016/j.bmc.2019.02.045]

Source