3-(3,5-Dibromophenyl)-N-[(2-thiophene-2-carbonyl)hydrazinocarbothioyl]acrylamide

ID: ALA4549519

PubChem CID: 89717857

Max Phase: Preclinical

Molecular Formula: C15H11Br2N3O2S2

Molecular Weight: 489.21

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(/C=C/c1cc(Br)cc(Br)c1)NC(=S)NNC(=O)c1cccs1

Standard InChI:  InChI=1S/C15H11Br2N3O2S2/c16-10-6-9(7-11(17)8-10)3-4-13(21)18-15(23)20-19-14(22)12-2-1-5-24-12/h1-8H,(H,19,22)(H2,18,20,21,23)/b4-3+

Standard InChI Key:  WHYZPGNYHOESOY-ONEGZZNKSA-N

Molfile:  

 
     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   17.8338   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5415   -9.3977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2492   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9569   -9.3977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.6646   -9.8063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.3723   -9.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0800   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1260   -9.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8338  -10.6235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3723   -8.5805    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.2492  -10.6235    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   22.1695  -10.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9689  -10.7846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3775  -10.0768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8306   -9.4697    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.4183   -9.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7106   -9.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7158   -8.5794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0089   -8.1709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3002   -8.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3028   -9.4010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0103   -9.8058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0093   -7.3537    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   13.5966   -9.8121    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  1  8  1  0
  1  9  2  0
  6 10  2  0
  3 11  2  0
  7 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15  7  1  0
  8 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 19 23  1  0
 21 24  1  0
M  END

Associated Targets(Human)

SRR Tbio Serine racemase (249 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 489.21Molecular Weight (Monoisotopic): 486.8659AlogP: 3.62#Rotatable Bonds: 3
Polar Surface Area: 70.23Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.06CX Basic pKa: CX LogP: 4.59CX LogD: 4.58
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.35Np Likeness Score: -1.97

References

1.  (2014)  Serine racemase inhibitor, 

Source