The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12beta-O-[Deca-2Z,4E-dienoyl]-13alpha-isobutyl-4beta-phorbol ID: ALA4549584
PubChem CID: 155543496
Max Phase: Preclinical
Molecular Formula: C34H48O8
Molecular Weight: 584.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C/C=C\C(=O)O[C@@H]1[C@@H](C)[C@@]2(O)[C@@H](C=C(CO)C[C@]3(O)C(=O)C(C)=C[C@@H]23)[C@@H]2C(C)(C)[C@]12OC(=O)C(C)C
Standard InChI: InChI=1S/C34H48O8/c1-8-9-10-11-12-13-14-15-26(36)41-29-22(5)33(40)24(27-31(6,7)34(27,29)42-30(38)20(2)3)17-23(19-35)18-32(39)25(33)16-21(4)28(32)37/h12-17,20,22,24-25,27,29,35,39-40H,8-11,18-19H2,1-7H3/b13-12+,15-14-/t22-,24+,25-,27-,29-,32-,33-,34-/m1/s1
Standard InChI Key: KYIPVUWVVGXMKA-LOPYHHCJSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
28.1034 -6.6703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3873 -7.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0914 -7.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8435 -7.4199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2019 -7.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4850 -8.6926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3021 -8.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5231 -7.8737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7819 -9.3223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6004 -9.3608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1389 -8.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0324 -9.3730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4153 -7.7045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9210 -10.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7323 -10.2107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0689 -9.4394 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2742 -7.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9976 -7.9391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9429 -6.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2438 -6.7345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7426 -7.0822 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.6951 -8.3567 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.5227 -6.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9173 -5.4852 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.6664 -6.6890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6942 -7.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2562 -8.0929 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.2495 -6.1155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0443 -8.3328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2438 -5.2952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9487 -4.8818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.6592 -5.2855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5333 -4.8915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.9431 -4.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1971 -5.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1715 -4.2822 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5026 -5.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7824 -5.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.7568 -4.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0366 -3.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0110 -3.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2908 -2.7374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2652 -1.9206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5450 -1.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5193 -0.7177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 17 1 0
7 9 1 0
9 10 1 0
18 11 1 0
10 11 2 0
6 12 2 0
5 13 1 0
10 14 1 0
14 15 1 0
7 16 1 1
17 18 1 0
17 20 1 0
18 26 1 0
25 19 1 0
19 20 1 0
8 21 1 6
18 22 1 1
20 23 1 6
19 24 1 1
26 25 1 0
2 26 1 0
25 2 1 0
26 27 1 6
25 28 1 6
17 29 1 6
28 30 1 0
30 31 1 0
31 32 1 0
30 33 2 0
31 34 1 0
24 35 1 0
35 36 2 0
35 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 584.75Molecular Weight (Monoisotopic): 584.3349AlogP: 4.38#Rotatable Bonds: 10Polar Surface Area: 130.36Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.57CX Basic pKa: ┄CX LogP: 5.03CX LogD: 5.03Aromatic Rings: ┄Heavy Atoms: 42QED Weighted: 0.11Np Likeness Score: 2.94
References 1. Nothias-Esposito M, Nothias LF, Da Silva RR, Retailleau P, Zhang Z, Leyssen P, Roussi F, Touboul D, Paolini J, Dorrestein PC, Litaudon M.. (2019) Investigation of Premyrsinane and Myrsinane Esters in Euphorbia cupanii and Euphobia pithyusa with MS2LDA and Combinatorial Molecular Network Annotation Propagation., 82 (6): [PMID:31181921 ] [10.1021/acs.jnatprod.8b00916 ]