The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((5-(2-(methylamino)pyridin-4-yl)-2-((4-morpholinophenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-4-yl)oxy)piperidin-1-yl)prop-2-en-1-one ID: ALA4549626
PubChem CID: 155543439
Max Phase: Preclinical
Molecular Formula: C30H34N8O3
Molecular Weight: 554.66
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)N1CCC(Oc2nc(Nc3ccc(N4CCOCC4)cc3)nc3[nH]cc(-c4ccnc(NC)c4)c23)CC1
Standard InChI: InChI=1S/C30H34N8O3/c1-3-26(39)38-12-9-23(10-13-38)41-29-27-24(20-8-11-32-25(18-20)31-2)19-33-28(27)35-30(36-29)34-21-4-6-22(7-5-21)37-14-16-40-17-15-37/h3-8,11,18-19,23H,1,9-10,12-17H2,2H3,(H,31,32)(H2,33,34,35,36)
Standard InChI Key: JHSHKERQDYXVKN-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
20.3788 -11.0940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3777 -11.9135 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0857 -12.3225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0839 -10.6851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.7926 -11.0904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7974 -11.9090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5774 -12.1574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0548 -11.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5696 -10.8329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6710 -10.6855 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9634 -11.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2557 -10.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5486 -11.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5484 -11.9103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2611 -12.3185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9653 -11.9081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8413 -12.3200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0868 -13.1396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3796 -13.5492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1345 -11.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4295 -12.3146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4266 -13.1321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1348 -13.5418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8459 -13.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8331 -12.9285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2881 -13.5389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.5446 -14.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3457 -14.4799 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.8898 -13.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.6304 -13.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6768 -13.1380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9718 -13.5440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9686 -14.3615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.6767 -14.7714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3879 -14.3637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2599 -14.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5532 -14.3580 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2578 -15.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5491 -15.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6907 -14.0270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9504 -14.8018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
3 18 1 0
19 18 1 0
17 20 1 0
17 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
7 25 1 0
19 31 1 0
19 35 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
33 36 1 0
36 37 2 0
36 38 1 0
38 39 2 0
29 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.66Molecular Weight (Monoisotopic): 554.2754AlogP: 4.20#Rotatable Bonds: 8Polar Surface Area: 120.53Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.29CX Basic pKa: 7.10CX LogP: 3.47CX LogD: 3.44Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.28Np Likeness Score: -0.89
References 1. Tang G, Liu L, Wang X, Pan Z.. (2019) Discovery of 7H-pyrrolo[2,3-d]pyrimidine derivatives as selective covalent irreversible inhibitors of interleukin-2-inducible T-cell kinase (Itk)., 173 [PMID:30999237 ] [10.1016/j.ejmech.2019.03.055 ]