The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-((S)-1-((S)-1-(4-(aminomethyl)phenyl)-4-(methylsulfonyl)but-3-en-2-ylamino)-4-methyl-1-oxopentan-2-ylamino)-4-methyl-1-oxopentan-2-yl)-6-phenylnicotinamide ID: ALA4549724
PubChem CID: 155550509
Max Phase: Preclinical
Molecular Formula: C36H47N5O5S
Molecular Weight: 661.87
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)c1ccc(-c2ccccc2)nc1)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](/C=C/S(C)(=O)=O)Cc1ccc(CN)cc1
Standard InChI: InChI=1S/C36H47N5O5S/c1-24(2)19-32(35(43)39-30(17-18-47(5,45)46)21-26-11-13-27(22-37)14-12-26)41-36(44)33(20-25(3)4)40-34(42)29-15-16-31(38-23-29)28-9-7-6-8-10-28/h6-18,23-25,30,32-33H,19-22,37H2,1-5H3,(H,39,43)(H,40,42)(H,41,44)/b18-17+/t30-,32+,33+/m1/s1
Standard InChI Key: NDVPAPQGOZGJQP-DPSBBIDJSA-N
Molfile:
RDKit 2D
47 49 0 0 0 0 0 0 0 0999 V2000
12.6995 -17.6274 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1122 -18.3373 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.5206 -17.6249 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7439 -18.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4516 -18.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1593 -18.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4516 -17.5242 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0362 -18.3414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3285 -18.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3285 -19.5672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8670 -18.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5747 -18.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2824 -18.3414 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5747 -19.5672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9901 -18.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6978 -18.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9901 -19.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4056 -18.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8210 -18.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6979 -19.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6938 -20.7940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4007 -21.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1094 -20.7939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1067 -19.9725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3993 -19.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8176 -21.2016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5248 -20.7920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6246 -18.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6259 -17.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9190 -17.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2104 -17.5233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2130 -18.3447 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9204 -18.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5045 -17.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5048 -16.2974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7973 -15.8898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0892 -16.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0929 -17.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8009 -17.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8670 -17.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7439 -19.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5747 -17.1156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5747 -16.2984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2824 -17.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4516 -19.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4516 -20.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1593 -19.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
5 7 2 0
4 8 1 0
8 9 1 0
9 10 2 0
6 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
15 17 1 6
16 18 2 0
18 2 1 0
2 19 1 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
9 28 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
31 34 1 0
11 40 1 1
4 41 1 6
40 42 1 0
42 43 1 0
42 44 1 0
41 45 1 0
45 46 1 0
45 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 661.87Molecular Weight (Monoisotopic): 661.3298AlogP: 4.17#Rotatable Bonds: 16Polar Surface Area: 160.35Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.24CX Basic pKa: 9.29CX LogP: 3.55CX LogD: 1.69Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.18Np Likeness Score: -0.27
References 1. Xin BT, Huber EM, de Bruin G, Heinemeyer W, Maurits E, Espinal C, Du Y, Janssens M, Weyburne ES, Kisselev AF, Florea BI, Driessen C, van der Marel GA, Groll M, Overkleeft HS.. (2019) Structure-Based Design of Inhibitors Selective for Human Proteasome β2c or β2i Subunits., 62 (3): [PMID:30657666 ] [10.1021/acs.jmedchem.8b01884 ]