N-(4-((4-((2-(dimethylphosphoryl)phenyl)amino)-7H-pyrrolo[2,3-d]pyrimidin-2-yl)amino)phenyl)acetamide

ID: ALA4549746

PubChem CID: 155550672

Max Phase: Preclinical

Molecular Formula: C22H23N6O2P

Molecular Weight: 434.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)Nc1ccc(Nc2nc(Nc3ccccc3P(C)(C)=O)c3cc[nH]c3n2)cc1

Standard InChI:  InChI=1S/C22H23N6O2P/c1-14(29)24-15-8-10-16(11-9-15)25-22-27-20-17(12-13-23-20)21(28-22)26-18-6-4-5-7-19(18)31(2,3)30/h4-13H,1-3H3,(H,24,29)(H3,23,25,26,27,28)

Standard InChI Key:  CNTZRYGAFOZZCJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   24.7677   -4.5474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7665   -5.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4787   -5.7800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1925   -5.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1868   -4.5468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4769   -4.1344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6472   -3.3329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4623   -3.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7974   -3.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9057   -5.7769    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0544   -5.7791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0537   -6.6004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3415   -7.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3405   -7.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0525   -8.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7670   -7.8291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7645   -7.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9104   -6.5940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2048   -7.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.2092   -7.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.9198   -8.2244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6274   -7.8073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6195   -6.9923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3228   -6.5761    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   29.0349   -6.9770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3140   -5.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.3169   -7.3919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0529   -9.0588    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.3455   -9.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3459  -10.2849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6375   -9.0595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  6  5  2  0
  6  1  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  4 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 10 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 24 27  1  0
 15 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4549746

    ---

Associated Targets(Human)

PTK2 Tclin Focal adhesion kinase 1 (4730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.44Molecular Weight (Monoisotopic): 434.1620AlogP: 4.65#Rotatable Bonds: 6
Polar Surface Area: 111.80Molecular Species: NEUTRALHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 13.17CX Basic pKa: 6.27CX LogP: 3.21CX LogD: 3.21
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -1.11

References

1. Wang R, Chen Y, Zhao X, Yu S, Yang B, Wu T, Guo J, Hao C, Zhao D, Cheng M..  (2019)  Design, synthesis and biological evaluation of novel 7H-pyrrolo[2,3-d]pyrimidine derivatives as potential FAK inhibitors and anticancer agents.,  183  [PMID:31550660] [10.1016/j.ejmech.2019.111716]

Source