The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3,3-difluoropropyl)-6-(hydroxymethyl)-1H,1'H-3,7'-biindole-5'-carbothioamide ID: ALA4549825
PubChem CID: 132137230
Max Phase: Preclinical
Molecular Formula: C21H19F2N3OS
Molecular Weight: 399.47
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=S)c1cc(-c2cn(CCC(F)F)c3cc(CO)ccc23)c2[nH]ccc2c1
Standard InChI: InChI=1S/C21H19F2N3OS/c22-19(23)4-6-26-10-17(15-2-1-12(11-27)7-18(15)26)16-9-14(21(24)28)8-13-3-5-25-20(13)16/h1-3,5,7-10,19,25,27H,4,6,11H2,(H2,24,28)
Standard InChI Key: LSGIVADUMIXMME-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
7.7961 -7.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7943 -5.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7959 -8.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1370 -8.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3893 -9.3128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4591 -8.5358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2077 -9.3094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7513 -9.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2499 -8.3652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9103 -9.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2441 -10.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7650 -11.3828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0989 -12.1287 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7953 -8.9644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5469 -9.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0960 -10.3453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8947 -10.1724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9522 -11.2989 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.5029 -6.0097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5077 -6.8283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2086 -5.5976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9183 -6.0027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2045 -4.7804 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.0880 -6.8329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0847 -6.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3028 -5.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8228 -6.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3082 -7.0897 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24 1 1 0
1 20 2 0
19 2 2 0
2 25 1 0
1 3 1 0
3 4 2 0
4 5 1 0
5 7 1 0
6 3 1 0
6 7 2 0
7 8 1 0
8 15 2 0
14 9 2 0
9 6 1 0
5 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
12 18 1 0
19 20 1 0
19 21 1 0
21 22 1 0
21 23 2 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 399.47Molecular Weight (Monoisotopic): 399.1217AlogP: 4.57#Rotatable Bonds: 6Polar Surface Area: 66.97Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.72CX Basic pKa: ┄CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.42Np Likeness Score: -0.60
References 1. (2017) Ash1l inhibitors and methods of treatment therewith,