The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-bromo-N-((S)-1-cyclohexyl-2-((S)-1-((S)-1-fluoro-6-guanidino-2-oxohexan-3-ylamino)-3-hydroxy-1-oxopropan-2-ylamino)-2-oxoethyl)benzamide ID: ALA4549870
PubChem CID: 126680468
Max Phase: Preclinical
Molecular Formula: C25H36BrFN6O5
Molecular Weight: 599.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@H](NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)c1ccc(Br)cc1)C1CCCCC1)C(=O)CF
Standard InChI: InChI=1S/C25H36BrFN6O5/c26-17-10-8-16(9-11-17)22(36)33-21(15-5-2-1-3-6-15)24(38)32-19(14-34)23(37)31-18(20(35)13-27)7-4-12-30-25(28)29/h8-11,15,18-19,21,34H,1-7,12-14H2,(H,31,37)(H,32,38)(H,33,36)(H4,28,29,30)/t18-,19-,21-/m0/s1
Standard InChI Key: ZWILCGHRFKXGKJ-ZJOUEHCJSA-N
Molfile:
RDKit 2D
38 39 0 0 0 0 0 0 0 0999 V2000
40.1180 -12.9043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8117 -14.1355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.8193 -13.3204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6222 -15.7922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.6146 -16.6073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9016 -17.0058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5328 -12.9178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
42.2341 -13.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9435 -12.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2266 -14.1490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9284 -14.5610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9208 -15.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9511 -12.1156 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.6479 -13.3450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3589 -12.9422 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.3175 -17.0241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.1277 -12.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8402 -11.6870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.4055 -13.3044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.7027 -12.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9901 -13.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7124 -12.0703 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.9804 -14.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2873 -12.8707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.5748 -13.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5651 -14.0880 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.2672 -14.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2556 -15.3145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9565 -15.7353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6708 -15.3364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6842 -14.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8757 -12.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8868 -12.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1848 -11.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4713 -12.0207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4642 -12.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1668 -13.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7679 -11.6046 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3 7 1 0
9 13 2 0
1 3 1 0
3 2 2 0
4 5 1 0
5 6 2 0
7 8 1 0
8 9 1 0
8 10 1 6
10 11 1 0
11 12 1 0
12 4 1 0
9 14 1 0
14 15 1 0
5 16 1 0
1 17 1 1
17 18 1 0
1 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 6
21 24 1 0
24 25 1 0
25 26 2 0
23 27 1 0
23 31 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
25 32 1 0
35 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 599.50Molecular Weight (Monoisotopic): 598.1915AlogP: 0.89#Rotatable Bonds: 14Polar Surface Area: 186.50Molecular Species: BASEHBA: 6HBD: 7#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.69CX Basic pKa: 12.08CX LogP: 0.52CX LogD: -1.42Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.09Np Likeness Score: 0.04
References 1. Hatcher JM, Du G, Fontán L, Us I, Qiao Q, Chennamadhavuni S, Shao J, Wu H, Melnick A, Gray NS, Scott DA.. (2019) Peptide-based covalent inhibitors of MALT1 paracaspase., 29 (11): [PMID:30954428 ] [10.1016/j.bmcl.2019.03.046 ]