The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-(3-amino-1-cyano-3-oxopropyl)-3-((4-(6-methylpyridine-3-yl)phenyl)sulphonyl)-2,2-dimethylpropanamide ID: ALA4549915
PubChem CID: 155550525
Max Phase: Preclinical
Molecular Formula: C21H24N4O4S
Molecular Weight: 428.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2ccc(S(=O)(=O)CC(C)(C)C(=O)N[C@H](C#N)CC(N)=O)cc2)cn1
Standard InChI: InChI=1S/C21H24N4O4S/c1-14-4-5-16(12-24-14)15-6-8-18(9-7-15)30(28,29)13-21(2,3)20(27)25-17(11-22)10-19(23)26/h4-9,12,17H,10,13H2,1-3H3,(H2,23,26)(H,25,27)/t17-/m0/s1
Standard InChI Key: ZJIFKWPSDDYXNO-KRWDZBQOSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
31.9159 -9.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.0875 -9.0015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.5002 -9.7114 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
30.9086 -8.9990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2684 -11.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2672 -12.1818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9753 -12.5907 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.6850 -12.1813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6821 -11.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9735 -10.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3853 -10.9487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0948 -11.3563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.8005 -10.9457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7978 -10.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0836 -9.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3809 -10.1348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2132 -10.1204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6286 -10.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6309 -10.9338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.3352 -9.7060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0441 -10.1127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.9116 -8.8901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.6216 -9.2945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7507 -9.7022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.4521 -9.2906 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
34.0463 -10.9299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7551 -11.3366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.7573 -12.1537 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.4617 -10.9260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5592 -12.5898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 2 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
14 3 1 0
3 17 1 0
17 1 1 0
1 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
1 22 1 0
1 23 1 0
21 24 1 0
24 25 3 0
21 26 1 6
26 27 1 0
27 28 1 0
27 29 2 0
6 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.51Molecular Weight (Monoisotopic): 428.1518AlogP: 1.74#Rotatable Bonds: 8Polar Surface Area: 143.01Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.31CX Basic pKa: 5.36CX LogP: 0.41CX LogD: 0.41Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.66Np Likeness Score: -1.09
References 1. Eddie SL, Gregson A, Graham E, Burton S, Harrison T, Burden R, Scott CJ, Mullan PB, Williams R.. (2019) Identification and SAR exploration of a novel series of Legumain inhibitors., 29 (12): [PMID:31005445 ] [10.1016/j.bmcl.2019.03.019 ]