3-(5-fluoro-1-(1-(methylsulfonyl)piperidin-4-yl)-1H-indol-3-yl)benzothioamide

ID: ALA4549932

PubChem CID: 132137317

Max Phase: Preclinical

Molecular Formula: C21H22FN3O2S2

Molecular Weight: 431.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)N1CCC(n2cc(-c3cccc(C(N)=S)c3)c3cc(F)ccc32)CC1

Standard InChI:  InChI=1S/C21H22FN3O2S2/c1-29(26,27)24-9-7-17(8-10-24)25-13-19(18-12-16(22)5-6-20(18)25)14-3-2-4-15(11-14)21(23)28/h2-6,11-13,17H,7-10H2,1H3,(H2,23,28)

Standard InChI Key:  XXSYQBPHKSVOIL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   10.9372   -9.0964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.2314   -8.6878    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.2304   -9.5033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8520   -2.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8508   -3.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5589   -3.9772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2685   -3.5678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2657   -2.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5571   -2.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9719   -2.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6811   -2.7398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5587   -4.7944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9688   -1.5167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   11.8998   -5.2709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1521   -6.0481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2220   -5.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9705   -6.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5141   -6.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3094   -6.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5581   -5.6998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0128   -5.1005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6731   -6.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8634   -6.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3848   -7.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7149   -8.0293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.5286   -8.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0121   -7.4531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4208   -8.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3566   -5.5259    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  8 10  1  0
 10 11  1  0
  6 12  1  0
 10 13  2  0
 12 14  2  0
 14 15  1  0
 15 17  1  0
 16 12  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 15 22  1  0
 22 23  1  0
 22 27  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 25  2  1  0
  2 28  1  0
 20 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4549932

    ---

Associated Targets(Human)

ASH1L Tbio Histone-lysine N-methyltransferase ASH1L (468 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 431.56Molecular Weight (Monoisotopic): 431.1137AlogP: 3.68#Rotatable Bonds: 4
Polar Surface Area: 68.33Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.69CX Basic pKa: CX LogP: 2.57CX LogD: 2.57
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.64Np Likeness Score: -1.38

References

1.  (2017)  Ash1l inhibitors and methods of treatment therewith, 

Source