The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(3-Amino-1H-indazol-6-yl)-N-(2-(4-methylbenzamido)ethyl)benzamide ID: ALA4549969
PubChem CID: 155550823
Max Phase: Preclinical
Molecular Formula: C24H23N5O2
Molecular Weight: 413.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)NCCNC(=O)c2ccc(-c3ccc4c(N)n[nH]c4c3)cc2)cc1
Standard InChI: InChI=1S/C24H23N5O2/c1-15-2-4-17(5-3-15)23(30)26-12-13-27-24(31)18-8-6-16(7-9-18)19-10-11-20-21(14-19)28-29-22(20)25/h2-11,14H,12-13H2,1H3,(H,26,30)(H,27,31)(H3,25,28,29)
Standard InChI Key: OGWDTZBATVFCOT-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
19.8393 -20.3251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5490 -19.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5461 -19.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2493 -18.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9588 -19.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6645 -18.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6619 -17.8621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9476 -17.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2449 -17.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3675 -17.4499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0773 -17.8549 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7829 -17.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4927 -17.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1983 -17.4355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.9081 -17.8404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6137 -17.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9122 -18.6576 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3633 -16.6327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3191 -17.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0242 -17.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0205 -16.6072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3058 -16.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6035 -16.6163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8373 -18.6831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1313 -19.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1280 -19.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3504 -18.8505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8731 -19.5130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3557 -20.1716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1064 -20.9498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.7256 -16.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25 1 1 0
1 2 2 0
2 3 1 0
3 24 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
3 4 1 0
7 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
10 18 2 0
16 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 16 1 0
26 24 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 25 1 0
29 30 1 0
21 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.48Molecular Weight (Monoisotopic): 413.1852AlogP: 3.28#Rotatable Bonds: 6Polar Surface Area: 112.90Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.44CX LogP: 3.17CX LogD: 3.17Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -0.75
References 1. Pan X, Liang L, Sun Y, Si R, Zhang Q, Wang J, Fu J, Zhang J, Zhang J.. (2019) Discovery of novel Bcr-AblT315I inhibitors with flexible linker. Part 1: Confirmation optimization of phenyl-1H-indazol-3-amine as hinge binding moiety., 178 [PMID:31185413 ] [10.1016/j.ejmech.2019.05.091 ]