5-(5-((4,6-dioxo-2-thioxotetrahydropyrimidin-5(6H)-ylidene)methyl)furan-2-yl)-2-ethylisoindoline-1,3-dione

ID: ALA4550132

PubChem CID: 1275855

Max Phase: Preclinical

Molecular Formula: C19H13N3O5S

Molecular Weight: 395.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1C(=O)c2ccc(-c3ccc(C=C4C(=O)NC(=S)NC4=O)o3)cc2C1=O

Standard InChI:  InChI=1S/C19H13N3O5S/c1-2-22-17(25)11-5-3-9(7-12(11)18(22)26)14-6-4-10(27-14)8-13-15(23)20-19(28)21-16(13)24/h3-8H,2H2,1H3,(H2,20,21,23,24,28)

Standard InChI Key:  ZTOXNVXRMPKNML-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 31  0  0  0  0  0  0  0  0999 V2000
   41.2277  -14.2567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9445  -13.8480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9465  -13.0272    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.2391  -12.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5224  -13.0195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.5131  -13.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.7964  -14.2531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6572  -14.2633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.2447  -11.7859    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   41.2256  -15.0817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9391  -15.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0275  -16.3155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.8341  -16.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2484  -15.7755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6978  -15.1611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1678  -17.2435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6790  -17.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0121  -18.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.9845  -17.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3202  -18.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8353  -18.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3213  -19.4156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1067  -19.1598    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.1059  -18.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.7729  -17.8484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.0670  -20.2005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.7745  -19.6442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.6890  -20.4647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  2  8  2  0
  4  9  2  0
  1 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 11  2  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 21  2  0
 20 19  2  0
 19 16  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 24 25  2  0
 22 26  2  0
 23 27  1  0
 27 28  1  0
M  END

Associated Targets(Human)

ENTPD5 Tbio Ectonucleoside triphosphate diphosphohydrolase 5 (478 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

pyrH Uridylate kinase (158 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.40Molecular Weight (Monoisotopic): 395.0576AlogP: 1.48#Rotatable Bonds: 3
Polar Surface Area: 108.72Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.43CX Basic pKa: CX LogP: 1.60CX LogD: 1.32
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.35Np Likeness Score: -1.11

References

1.  (2012)  Entpd5 inhibitors, 

Source