The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(5-((4,6-dioxo-2-thioxotetrahydropyrimidin-5(6H)-ylidene)methyl)furan-2-yl)-2-ethylisoindoline-1,3-dione ID: ALA4550132
PubChem CID: 1275855
Max Phase: Preclinical
Molecular Formula: C19H13N3O5S
Molecular Weight: 395.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN1C(=O)c2ccc(-c3ccc(C=C4C(=O)NC(=S)NC4=O)o3)cc2C1=O
Standard InChI: InChI=1S/C19H13N3O5S/c1-2-22-17(25)11-5-3-9(7-12(11)18(22)26)14-6-4-10(27-14)8-13-15(23)20-19(28)21-16(13)24/h3-8H,2H2,1H3,(H2,20,21,23,24,28)
Standard InChI Key: ZTOXNVXRMPKNML-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
41.2277 -14.2567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9445 -13.8480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9465 -13.0272 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.2391 -12.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.5224 -13.0195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.5131 -13.8445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7964 -14.2531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.6572 -14.2633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
41.2447 -11.7859 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.2256 -15.0817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9391 -15.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.0275 -16.3155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.8341 -16.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.2484 -15.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6978 -15.1611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1678 -17.2435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.6790 -17.9078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.0121 -18.6618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.9845 -17.3280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3202 -18.0793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.8353 -18.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3213 -19.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.1067 -19.1598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.1059 -18.3339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7729 -17.8484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
44.0670 -20.2005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
45.7745 -19.6442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.6890 -20.4647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
2 8 2 0
4 9 2 0
1 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 11 2 0
13 16 1 0
16 17 2 0
17 18 1 0
18 21 2 0
20 19 2 0
19 16 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 20 1 0
24 25 2 0
22 26 2 0
23 27 1 0
27 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.40Molecular Weight (Monoisotopic): 395.0576AlogP: 1.48#Rotatable Bonds: 3Polar Surface Area: 108.72Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.43CX Basic pKa: ┄CX LogP: 1.60CX LogD: 1.32Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.35Np Likeness Score: -1.11
References 1. (2012) Entpd5 inhibitors,