6-([1,1'-Biphenyl]-2-yl)benzo[b]pyrrolo[1,2-d][1,4]oxazepin-7-yl acetate

ID: ALA4550137

PubChem CID: 155550299

Max Phase: Preclinical

Molecular Formula: C29H26N2O3

Molecular Weight: 450.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)C(=O)OC1=C(c2ccccc2-c2ccccc2)Oc2ccccc2-n2cccc21

Standard InChI:  InChI=1S/C29H26N2O3/c1-3-30(4-2)29(32)34-28-25-18-12-20-31(25)24-17-10-11-19-26(24)33-27(28)23-16-9-8-15-22(23)21-13-6-5-7-14-21/h5-20H,3-4H2,1-2H3

Standard InChI Key:  KXWYRPGWLQIVMC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
    7.0730  -11.1806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8119  -11.5456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9938  -12.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4691  -12.9904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6440  -12.9885    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3884  -13.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0558  -14.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7211  -13.7760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1306  -12.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3277  -11.5265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7270  -10.9568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3414  -12.5661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4617  -11.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2294  -11.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8800  -10.8367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7643  -10.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3449  -10.2247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9919   -9.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7435  -12.0041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9356  -11.1973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7977  -12.5419    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0324  -13.3342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8363  -13.5291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4631  -13.9355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.0680  -14.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4036  -12.9339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2026  -13.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8670  -14.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5786   -9.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5682   -8.9086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9848   -9.4920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1983  -10.2889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9952  -10.5024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3651   -9.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10  1  1  0
  1  2  1  0
  2  3  2  0
  9  5  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  2  0
  9 10  2  0
 10 11  1  0
 11 20  2  0
 19 12  2  0
 12  9  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 18  1  0
 17 13  1  0
  2 13  1  0
 17 18  2  0
 19 20  1  0
  3 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 23 25  1  0
 23 26  1  0
 26 27  1  0
 25 28  1  0
 17 29  1  0
 33 29  2  0
 29 34  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 30 34  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4550137

    ---

Associated Targets(Human)

SCC-4 (168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H929 (451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Ca9-22 (362 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 450.54Molecular Weight (Monoisotopic): 450.1943AlogP: 6.84#Rotatable Bonds: 5
Polar Surface Area: 43.70Molecular Species: HBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.90CX LogD: 5.90
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -0.35

References

1. Brindisi M, Ulivieri C, Alfano G, Gemma S, de Asís Balaguer F, Khan T, Grillo A, Chemi G, Menchon G, Prota AE, Olieric N, Lucena-Agell D, Barasoain I, Diaz JF, Nebbioso A, Conte M, Lopresti L, Magnano S, Amet R, Kinsella P, Zisterer DM, Ibrahim O, O'Sullivan J, Morbidelli L, Spaccapelo R, Baldari C, Butini S, Novellino E, Campiani G, Altucci L, Steinmetz MO, Brogi S..  (2019)  Structure-activity relationships, biological evaluation and structural studies of novel pyrrolonaphthoxazepines as antitumor agents.,  162  [PMID:30448418] [10.1016/j.ejmech.2018.11.004]

Source