The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2'E)-1-(3,17beta-dihydroxy-1,3,5(10)-estratrienyl)-3'-(4''-benzyloxyphenyl)prop-2'-en-1'-one ID: ALA4550270
PubChem CID: 155550489
Max Phase: Preclinical
Molecular Formula: C34H36O4
Molecular Weight: 508.66
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H]3c4cc(C(=O)/C=C/c5ccc(OCc6ccccc6)cc5)c(O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O
Standard InChI: InChI=1S/C34H36O4/c1-34-18-17-26-27(30(34)14-16-33(34)37)13-10-24-19-32(36)29(20-28(24)26)31(35)15-9-22-7-11-25(12-8-22)38-21-23-5-3-2-4-6-23/h2-9,11-12,15,19-20,26-27,30,33,36-37H,10,13-14,16-18,21H2,1H3/b15-9+/t26-,27+,30-,33-,34-/m0/s1
Standard InChI Key: LEOWSYBFIRTQRP-FAIBGYDESA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
23.9415 -11.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9404 -11.8364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6545 -12.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6527 -10.5975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3673 -11.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3661 -11.8385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0823 -12.2534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8043 -11.8406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0847 -10.5888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8054 -11.0119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8158 -9.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0868 -9.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5365 -9.7667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5278 -10.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3179 -10.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8151 -10.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3321 -9.5174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2263 -12.2480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.5950 -8.7363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5311 -8.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7985 -10.1857 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
27.5227 -11.4220 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
26.0784 -11.4095 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
23.2277 -10.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2275 -9.7738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.5140 -11.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8002 -10.5983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0865 -11.0106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3732 -10.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6600 -11.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6597 -11.8335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3786 -12.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0888 -11.8314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9465 -12.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2322 -11.8357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5190 -12.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8070 -11.8373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0944 -12.2499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0952 -13.0749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8146 -13.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5243 -13.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 9 1 0
6 7 1 0
7 8 1 0
8 10 1 0
9 10 1 0
9 12 1 0
10 14 1 0
13 11 1 0
11 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
2 18 1 0
17 19 1 1
13 20 1 1
10 21 1 1
14 22 1 6
9 23 1 6
1 24 1 0
24 25 2 0
24 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.66Molecular Weight (Monoisotopic): 508.2614AlogP: 7.08#Rotatable Bonds: 6Polar Surface Area: 66.76Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.50CX Basic pKa: ┄CX LogP: 7.88CX LogD: 7.63Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.28Np Likeness Score: 1.08
References 1. Wang C, Li L, Fu D, Qin T, Ran Y, Xu F, Du X, Gao H, Sun S, Yang T, Zhang X, Huo J, Zhao W, Zhang Z, Shi X.. (2019) Discovery of chalcone-modified estradiol analogs as antitumour agents that Inhibit tumour angiogenesis and epithelial to mesenchymal transition., 176 [PMID:31102934 ] [10.1016/j.ejmech.2019.04.071 ]