The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R*,2R*)-2-(Pyridin-2-yl)cyclopropanecarboxylic Acid [(2R,3R)-2-Amino-3-methoxybutyl]-(4'-methoxybiphenyl-4-yl)amide dihydrochloride ID: ALA4550415
PubChem CID: 155555151
Max Phase: Preclinical
Molecular Formula: C27H33Cl2N3O3
Molecular Weight: 445.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(N(C[C@@H](N)[C@@H](C)OC)C(=O)[C@@H]3C[C@H]3c3ccccn3)cc2)cc1.Cl.Cl
Standard InChI: InChI=1S/C27H31N3O3.2ClH/c1-18(32-2)25(28)17-30(27(31)24-16-23(24)26-6-4-5-15-29-26)21-11-7-19(8-12-21)20-9-13-22(33-3)14-10-20;;/h4-15,18,23-25H,16-17,28H2,1-3H3;2*1H/t18-,23-,24-,25-;;/m1../s1
Standard InChI Key: DWZQZUULIDASJG-NXMUYZBISA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
10.0333 -25.2164 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.9006 -28.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8995 -29.4041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6149 -29.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3319 -29.4036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3290 -28.5731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6131 -28.1661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0394 -28.1614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7521 -28.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4651 -28.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4625 -27.3325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7410 -26.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0350 -27.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1754 -26.9143 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8926 -27.3252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1713 -26.0893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8967 -28.1502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6055 -26.9070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4542 -25.6825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7412 -26.0965 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4272 -26.9018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0090 -26.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1446 -27.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1467 -28.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8632 -28.5405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5727 -28.1259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5653 -27.2967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8523 -26.8901 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4499 -24.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1628 -24.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7328 -24.4465 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7286 -23.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1841 -29.8182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4694 -29.4030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9086 -25.1571 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 8 1 0
11 14 1 0
14 15 1 0
14 16 1 0
15 17 2 0
18 15 1 6
16 19 1 0
19 20 1 1
21 18 1 0
22 21 1 0
18 22 1 0
21 23 1 1
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
19 29 1 0
29 30 1 6
29 31 1 0
31 32 1 0
3 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.56Molecular Weight (Monoisotopic): 445.2365AlogP: 4.26#Rotatable Bonds: 9Polar Surface Area: 77.68Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.59CX LogP: 3.31CX LogD: 2.10Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -0.59
References 1. Jin C, Decker AM, Makhijani VH, Besheer J, Darcq E, Kieffer BL, Maitra R.. (2018) Discovery of a Potent, Selective, and Brain-Penetrant Small Molecule that Activates the Orphan Receptor GPR88 and Reduces Alcohol Intake., 61 (15): [PMID:30011199 ] [10.1021/acs.jmedchem.8b00566 ]