Onydecalin B

ID: ALA4550460

PubChem CID: 155554913

Max Phase: Preclinical

Molecular Formula: C21H32O4

Molecular Weight: 348.48

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C/C=C(\C)[C@H]1C(C)=C[C@H]2C[C@@H](C)C[C@@H](C(=O)O)[C@@H]2[C@@]1(C)C(=O)CCO

Standard InChI:  InChI=1S/C21H32O4/c1-6-13(3)18-14(4)11-15-9-12(2)10-16(20(24)25)19(15)21(18,5)17(23)7-8-22/h6,11-12,15-16,18-19,22H,7-10H2,1-5H3,(H,24,25)/b13-6+/t12-,15-,16-,18+,19-,21+/m1/s1

Standard InChI Key:  LCAKZDTYAJEGJC-QPYQJHIMSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   13.7242   -7.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4052   -7.2110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0431   -7.2191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7048   -9.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7048  -10.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3812  -10.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3812   -9.2615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0617   -9.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0583  -10.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7314  -10.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4126  -10.4479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4160   -9.6637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7384   -9.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3812   -8.4773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0642   -8.0852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7024   -8.0852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0544   -8.8735    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.0266  -10.8391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0503  -11.2261    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   15.0932  -10.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4123   -8.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1011   -9.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7778   -9.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1054   -8.4912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4587   -9.2828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1098   -7.6136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8082   -7.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  4  5  1  0
  4  7  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
  7 14  1  1
 14 15  2  0
 14 16  1  0
  8 17  1  1
  5 18  1  1
  9 19  1  6
 11 20  1  0
 13  1  1  0
 13 21  1  6
 12 22  1  1
 22 23  2  0
 22 24  1  0
 23 25  1  0
  2 26  1  0
 26 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4550460

    ---

Associated Targets(Human)

TRPM8 Tclin Transient receptor potential cation channel subfamily M member 8 (1168 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Histoplasma capsulatum (403 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Aspergillus fumigatus (16427 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.48Molecular Weight (Monoisotopic): 348.2301AlogP: 3.85#Rotatable Bonds: 5
Polar Surface Area: 74.60Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.74CX Basic pKa: CX LogP: 3.64CX LogD: 1.04
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.74Np Likeness Score: 2.10

References

1. Lin Z, Phadke S, Lu Z, Beyhan S, Abdel Aziz MH, Reilly C, Schmidt EW..  (2018)  Onydecalins, Fungal Polyketides with Anti- Histoplasma and Anti-TRP Activity.,  81  (12): [PMID:30507122] [10.1021/acs.jnatprod.7b01067]

Source