The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ophiobolin Q ID: ALA4550481
PubChem CID: 73386894
Max Phase: Preclinical
Molecular Formula: C25H36O4
Molecular Weight: 400.56
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=CC(=O)[C@H]2/C(C=O)=C\C[C@H]3[C@@H]([C@@H](C)/C=C\[C@H](O)C(C)(C)O)CC[C@]3(C)C[C@H]12
Standard InChI: InChI=1S/C25H36O4/c1-15(6-9-22(28)24(3,4)29)18-10-11-25(5)13-19-16(2)12-21(27)23(19)17(14-26)7-8-20(18)25/h6-7,9,12,14-15,18-20,22-23,28-29H,8,10-11,13H2,1-5H3/b9-6-,17-7-/t15-,18+,19+,20-,22-,23-,25+/m0/s1
Standard InChI Key: ZCYAUPOUCSSQGA-WBBAMFPJSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
44.1655 -18.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.3772 -17.9122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5890 -18.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7956 -17.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6152 -19.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.6152 -17.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.7957 -19.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6214 -20.0232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4234 -20.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2270 -18.8574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2205 -18.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.4447 -19.1184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1903 -18.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.1895 -18.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9680 -19.1055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.4501 -18.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9694 -17.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1992 -20.1367 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
41.1815 -19.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.7773 -16.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3693 -16.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.9934 -16.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4002 -17.2394 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
38.4643 -17.7230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.5153 -18.4487 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
37.7387 -18.7068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.7910 -20.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.5435 -17.1940 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
43.1832 -16.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.5942 -17.1244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.4113 -17.1217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.5864 -18.1181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.3544 -16.9132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
11 4 2 0
7 5 1 0
5 14 1 0
13 6 1 0
6 4 1 0
7 10 1 0
12 8 1 0
8 9 2 0
9 7 1 0
10 11 1 0
12 10 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
7 18 1 1
14 19 1 1
17 20 1 0
20 21 1 0
20 22 1 1
13 23 1 6
11 24 1 0
10 25 1 6
12 26 2 0
9 27 1 0
17 28 1 6
21 29 2 0
29 30 1 0
30 31 1 6
30 2 1 0
2 32 1 0
24 33 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.56Molecular Weight (Monoisotopic): 400.2614AlogP: 4.02#Rotatable Bonds: 5Polar Surface Area: 74.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.48CX Basic pKa: ┄CX LogP: 3.53CX LogD: 3.53Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.54Np Likeness Score: 2.85
References 1. Cai R, Jiang H, Mo Y, Guo H, Li C, Long Y, Zang Z, She Z.. (2019) Ophiobolin-Type Sesterterpenoids from the Mangrove Endophytic Fungus Aspergillus sp. ZJ-68., 82 (8): [PMID:31365251 ] [10.1021/acs.jnatprod.9b00462 ]