The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 3-(2-(7-(hydroxyamino)-7-oxoheptanamido)thiazol-4-yl)phenylcarbamate ID: ALA4550526
PubChem CID: 155554844
Max Phase: Preclinical
Molecular Formula: C21H28N4O5S
Molecular Weight: 448.55
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)Nc1cccc(-c2csc(NC(=O)CCCCCC(=O)NO)n2)c1
Standard InChI: InChI=1S/C21H28N4O5S/c1-21(2,3)30-20(28)22-15-9-7-8-14(12-15)16-13-31-19(23-16)24-17(26)10-5-4-6-11-18(27)25-29/h7-9,12-13,29H,4-6,10-11H2,1-3H3,(H,22,28)(H,25,27)(H,23,24,26)
Standard InChI Key: FXKMDFMOXSKKIB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
6.9553 -18.3098 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6645 -18.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3707 -18.3044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6676 -19.5329 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0799 -18.7104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7861 -18.2991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4953 -18.7050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2015 -18.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9107 -18.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6169 -18.2884 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9138 -19.5169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3261 -18.6944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2491 -18.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5019 -18.3923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9574 -19.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3687 -19.7079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1673 -19.5349 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.9179 -19.7048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7333 -19.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1402 -19.0015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7328 -18.2954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9143 -18.2982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5111 -19.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5031 -17.5920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9090 -16.8828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4977 -16.1766 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7262 -16.8797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9036 -15.4674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7208 -15.4643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4924 -14.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3059 -14.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
1 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
20 15 1 0
22 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.55Molecular Weight (Monoisotopic): 448.1780AlogP: 4.55#Rotatable Bonds: 9Polar Surface Area: 129.65Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.92CX Basic pKa: ┄CX LogP: 3.85CX LogD: 3.73Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.25Np Likeness Score: -1.46
References 1. Amin SA, Adhikari N, Kotagiri S, Jha T, Ghosh B.. (2019) Histone deacetylase 3 inhibitors in learning and memory processes with special emphasis on benzamides., 166 [PMID:30735902 ] [10.1016/j.ejmech.2019.01.077 ]