The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl (S)-5-((1r,4S)-4-(aminomethyl)cyclohexanecarboxamido)-7-(4-benzoylphenoxy)-6-oxoheptylcarbamate ID: ALA4550530
PubChem CID: 15101698
Max Phase: Preclinical
Molecular Formula: C36H43N3O6
Molecular Weight: 613.76
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC[C@H]1CC[C@H](C(=O)N[C@@H](CCCCNC(=O)OCc2ccccc2)C(=O)COc2ccc(C(=O)c3ccccc3)cc2)CC1
Standard InChI: InChI=1S/C36H43N3O6/c37-23-26-14-16-30(17-15-26)35(42)39-32(13-7-8-22-38-36(43)45-24-27-9-3-1-4-10-27)33(40)25-44-31-20-18-29(19-21-31)34(41)28-11-5-2-6-12-28/h1-6,9-12,18-21,26,30,32H,7-8,13-17,22-25,37H2,(H,38,43)(H,39,42)/t26-,30-,32-/m0/s1
Standard InChI Key: OYTXYKWUMMBPBX-SWCXXNJTSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
8.8776 -7.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5835 -6.3693 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5835 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2935 -7.6002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0036 -7.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7136 -8.4195 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7136 -7.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0036 -6.3693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7136 -5.9617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7136 -5.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4237 -4.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4237 -3.9115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1723 -7.1898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4685 -7.5980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4679 -8.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1772 -8.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8872 -8.4134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7604 -8.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0525 -8.4164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.4217 -7.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1291 -7.6015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8371 -7.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5393 -7.6061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2469 -7.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2481 -6.3808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5357 -5.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8311 -6.3813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9556 -5.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6635 -6.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9553 -5.1547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6592 -7.1948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3662 -7.6031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0748 -7.1941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0718 -6.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3642 -5.9682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1314 -3.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1314 -2.6857 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.8391 -3.9115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.5468 -3.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5468 -2.6857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2554 -2.2827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2558 -1.4662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5475 -1.0568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8375 -1.4698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8406 -2.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
1 3 1 1
3 2 2 0
4 5 1 0
5 7 1 0
7 6 2 0
5 8 1 1
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
1 13 1 0
1 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
15 18 1 6
18 19 1 0
7 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
25 28 1 0
28 29 1 0
28 30 2 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 29 1 0
12 36 1 0
36 37 2 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 613.76Molecular Weight (Monoisotopic): 613.3152AlogP: 5.21#Rotatable Bonds: 16Polar Surface Area: 136.82Molecular Species: BASEHBA: 7HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.70CX Basic pKa: 10.02CX LogP: 5.51CX LogD: 3.03Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.15Np Likeness Score: -0.52
References 1. Steinmetzer T, Pilgram O, Wenzel BM, Wiedemeyer SJA.. (2020) Fibrinolysis Inhibitors: Potential Drugs for the Treatment and Prevention of Bleeding., 63 (4): [PMID:31658420 ] [10.1021/acs.jmedchem.9b01060 ]