The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-4-{[(S)-2-Carboxy-2-(2,4,6-trimethyl-benzenesulfonylamino)-ethylcarbamoyl]-methoxy}-2-(pyrimidin-2-ylaminomethyl)-pyrrolidine-1-carboxylic acid benzyl ester ID: ALA4550545
PubChem CID: 58916174
Max Phase: Preclinical
Molecular Formula: C31H38N6O8S
Molecular Weight: 654.75
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(C)c(S(=O)(=O)N[C@@H](CNC(=O)CO[C@@H]2C[C@@H](CNc3ncccn3)N(C(=O)OCc3ccccc3)C2)C(=O)O)c(C)c1
Standard InChI: InChI=1S/C31H38N6O8S/c1-20-12-21(2)28(22(3)13-20)46(42,43)36-26(29(39)40)16-34-27(38)19-44-25-14-24(15-35-30-32-10-7-11-33-30)37(17-25)31(41)45-18-23-8-5-4-6-9-23/h4-13,24-26,36H,14-19H2,1-3H3,(H,34,38)(H,39,40)(H,32,33,35)/t24-,25+,26-/m0/s1
Standard InChI Key: WITKOOSDPDRQHM-NXCFDTQHSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
10.7072 -9.1579 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5295 -9.1622 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.1220 -8.4479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4178 -9.9774 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6480 -10.2908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9928 -9.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1116 -8.9542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5866 -8.3125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7667 -8.4505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2379 -7.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4433 -8.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1740 -8.8463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3513 -8.8298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1173 -8.0473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3271 -7.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1631 -6.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3809 -6.6976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2188 -5.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8445 -5.3491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6871 -4.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9043 -4.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2788 -4.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4436 -5.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7053 -8.3215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8007 -7.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7855 -9.4302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9917 -9.2410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4298 -9.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6260 -9.6491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0602 -10.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3110 -11.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1020 -11.2302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6719 -10.6256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8779 -7.5357 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5334 -11.1137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7634 -11.4229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.1870 -11.6194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2919 -8.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9373 -9.3607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6983 -9.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8112 -8.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1569 -7.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3985 -8.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7466 -7.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8222 -10.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5725 -7.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 6
6 5 1 0
7 6 1 0
8 7 1 0
9 8 1 0
10 9 1 0
11 10 1 6
12 11 1 0
13 12 1 0
14 13 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
15 24 2 0
14 25 1 0
11 25 1 0
13 26 1 1
26 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
8 34 2 0
5 35 1 0
35 36 2 0
35 37 1 0
4 2 1 0
2 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
43 44 1 0
39 45 1 0
41 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 654.75Molecular Weight (Monoisotopic): 654.2472AlogP: 2.16#Rotatable Bonds: 14Polar Surface Area: 189.15Molecular Species: ACIDHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.33CX Basic pKa: 4.19CX LogP: 1.86CX LogD: -0.89Aromatic Rings: 3Heavy Atoms: 46QED Weighted: 0.20Np Likeness Score: -0.92
References 1. (2013) Compounds for the inhibition of angiogenesis and use thereof,