The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-methoxy-5-(1-(4-methoxybenzyl)-3-methyl-2-oxo-2,3-dihydro-1H-imidazo[4,5-c]quinolin-8-yl)pyridin-3-yl)methanesulfonamide ID: ALA4550603
PubChem CID: 77107927
Max Phase: Preclinical
Molecular Formula: C26H25N5O5S
Molecular Weight: 519.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cn2c(=O)n(C)c3cnc4ccc(-c5cnc(OC)c(NS(C)(=O)=O)c5)cc4c32)cc1
Standard InChI: InChI=1S/C26H25N5O5S/c1-30-23-14-27-21-10-7-17(18-12-22(29-37(4,33)34)25(36-3)28-13-18)11-20(21)24(23)31(26(30)32)15-16-5-8-19(35-2)9-6-16/h5-14,29H,15H2,1-4H3
Standard InChI Key: KABBATBNPHTWDK-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
17.2972 -23.3477 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4800 -23.3477 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
16.8886 -24.0554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3016 -22.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3005 -23.3459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0085 -23.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0067 -22.1175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7154 -22.5228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7161 -23.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4247 -23.7489 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.1329 -23.3380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4191 -22.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1249 -22.5169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7276 -21.9706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3943 -21.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5856 -21.3163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8005 -20.5194 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.0368 -20.7109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5275 -22.1379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2867 -19.9328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0852 -19.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3352 -18.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7861 -18.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9838 -18.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7375 -19.3352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0350 -17.6038 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.8335 -17.4301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5938 -22.1179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5970 -21.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8901 -20.8915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1815 -21.3003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1843 -22.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8919 -22.5264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4731 -20.8928 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7661 -21.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4781 -22.5330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.7751 -23.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 13 1 0
12 8 1 0
12 13 2 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
15 17 2 0
16 18 1 0
14 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
23 26 1 0
26 27 1 0
4 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
31 34 1 0
34 35 1 0
32 36 1 0
36 2 1 0
2 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 519.58Molecular Weight (Monoisotopic): 519.1576AlogP: 3.39#Rotatable Bonds: 7Polar Surface Area: 117.34Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.78CX Basic pKa: 3.02CX LogP: 2.20CX LogD: 2.07Aromatic Rings: 5Heavy Atoms: 37QED Weighted: 0.35Np Likeness Score: -1.23
References 1. Bahekar R, Dave B, Soman S, Patel D, Chopade R, Funde R, Kumar J, Sachchidanand S, Giri P, Chatterjee A, Mahapatra J, Vyas P, Ghoshdastidar K, Bandyopadhyay D, Desai RC.. (2019) Discovery of 1,3-dihydro-2H-imidazo[4,5-c]quinolin-2-ones based novel, potent and PI3Kδ selective inhibitors., 29 (11): [PMID:30975623 ] [10.1016/j.bmcl.2019.04.007 ]