4-[2-{[6-(4-Bromophenyl)-2-ethylimidazo[2,1-b][1,3,4]thiadiazol-5-ylmethylene]hydrazono}-4-(4-nitrophenyl)thiazol-3-yl]phenol

ID: ALA4550734

PubChem CID: 155554854

Max Phase: Preclinical

Molecular Formula: C28H20BrN7O3S2

Molecular Weight: 646.55

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1nn2c(/C=N/N=c3\scc(-c4ccc([N+](=O)[O-])cc4)n3-c3ccc(O)cc3)c(-c3ccc(Br)cc3)nc2s1

Standard InChI:  InChI=1S/C28H20BrN7O3S2/c1-2-25-33-35-23(26(31-27(35)41-25)18-3-7-19(29)8-4-18)15-30-32-28-34(20-11-13-22(37)14-12-20)24(16-40-28)17-5-9-21(10-6-17)36(38)39/h3-16,37H,2H2,1H3/b30-15+,32-28-

Standard InChI Key:  OIPQLODOTUGOMK-OTCZRHILSA-N

Molfile:  

 
     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
    8.3217  -25.8241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3032  -24.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8308  -25.1596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0969  -24.7264    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1060  -25.5548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8968  -25.8049    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.3781  -25.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8820  -24.4631    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0073  -25.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5818  -24.4584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7544  -24.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3515  -25.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7779  -25.9079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6039  -25.8933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0369  -23.6973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2242  -23.5381    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9578  -22.7540    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1495  -22.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8032  -21.8484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9849  -21.9455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8243  -22.7538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5434  -23.1562    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2024  -21.1294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0275  -21.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4289  -20.3997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0063  -19.6911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1781  -19.7061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7804  -20.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4068  -18.9784    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2022  -25.1194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6221  -25.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4271  -21.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6729  -20.5554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1141  -19.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3095  -20.1325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0665  -20.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6270  -21.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5276  -25.2061    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.7468  -19.5288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9432  -19.7119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9899  -18.7414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  5  2  0
  4  2  1  0
  2  3  2  0
  3  1  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
  3  9  1  0
  2 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 18  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 19 23  1  0
 26 29  1  0
  7 30  1  0
 30 31  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
 20 32  1  0
 12 38  1  0
 39 40  2  0
 39 41  1  0
 35 39  1  0
M  CHG  2  39   1  41  -1
M  END

Alternative Forms

  1. Parent:

    ALA4550734

    ---

Associated Targets(non-human)

Trypanosoma brucei gambiense (523 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 646.55Molecular Weight (Monoisotopic): 645.0252AlogP: 6.85#Rotatable Bonds: 7
Polar Surface Area: 123.21Molecular Species: NEUTRALHBA: 11HBD: 1
#RO5 Violations: 3HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.18CX Basic pKa: 1.99CX LogP: 7.45CX LogD: 7.44
Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.12Np Likeness Score: -1.68

References

1. Kryshchyshyn A, Kaminskyy D, Karpenko O, Gzella A, Grellier P, Lesyk R..  (2019)  Thiazolidinone/thiazole based hybrids - New class of antitrypanosomal agents.,  174  [PMID:31051403] [10.1016/j.ejmech.2019.04.052]

Source