Scequinadoline A

ID: ALA4550739

PubChem CID: 155554957

Max Phase: Preclinical

Molecular Formula: C27H31N5O3

Molecular Weight: 473.58

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)[C@@H]1NC[C@@H](C[C@@]2(O)c3ccccc3N3C(=O)C(C)(C)N[C@@H]32)n2c1nc1ccccc1c2=O

Standard InChI:  InChI=1S/C27H31N5O3/c1-15(2)21-22-29-19-11-7-5-9-17(19)23(33)31(22)16(14-28-21)13-27(35)18-10-6-8-12-20(18)32-24(27)30-26(3,4)25(32)34/h5-12,15-16,21,24,28,30,35H,13-14H2,1-4H3/t16-,21+,24+,27-/m1/s1

Standard InChI Key:  LZKWHOGZWGGIPZ-KCLYJWAJSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   44.8919  -11.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.6814  -12.0350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.4729  -11.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4932  -10.4419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4921  -11.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2001  -11.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1984  -10.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9070  -10.4383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.9058  -11.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6120  -11.6679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.6143  -10.0267    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.3250  -10.4403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3216  -11.2589    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.0250  -11.6689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7362  -11.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7397  -10.4462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.0318  -10.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0204  -12.4861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7258  -12.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.4752  -12.5695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0185  -13.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.7644  -12.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8853  -11.8650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.6061  -13.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8103  -13.7086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2614  -14.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.5072  -15.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3070  -15.2593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8524  -14.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0152  -13.3021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.4707  -13.2592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6112  -12.4851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.0341   -9.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7430   -8.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3275   -8.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8902  -11.9855    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  9  2  0
  8  7  2  0
  7  4  1  0
  8  9  1  0
  8 11  1  0
  9 10  1  0
 10 13  1  0
 12 11  2  0
 12 13  1  0
 12 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 14 18  1  1
 18 19  1  0
 19 25  1  0
 24 21  1  0
 20 19  1  0
 20 21  1  0
 21 22  1  0
 22  2  1  0
  2 23  1  0
 20 23  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 19 30  1  1
 22 31  2  0
 10 32  2  0
 17 33  1  6
 33 34  1  0
 33 35  1  0
 20 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA4550739

    ---

Associated Targets(non-human)

Dengue virus (413 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.58Molecular Weight (Monoisotopic): 473.2427AlogP: 2.57#Rotatable Bonds: 3
Polar Surface Area: 99.49Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.92CX Basic pKa: 6.35CX LogP: 2.52CX LogD: 2.49
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: 0.80

References

1. Dighe SN, Ekwudu O, Dua K, Chellappan DK, Katavic PL, Collet TA..  (2019)  Recent update on anti-dengue drug discovery.,  176  [PMID:31128447] [10.1016/j.ejmech.2019.05.010]

Source