3,5-diamino-6-(benzofuran-5-yl)-N-carbamimidoylpyrazine-2-carboxamide

ID: ALA4550786

PubChem CID: 155555188

Max Phase: Preclinical

Molecular Formula: C14H13N7O2

Molecular Weight: 311.31

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N=C(N)NC(=O)c1nc(-c2ccc3occc3c2)c(N)nc1N

Standard InChI:  InChI=1S/C14H13N7O2/c15-11-9(7-1-2-8-6(5-7)3-4-23-8)19-10(12(16)20-11)13(22)21-14(17)18/h1-5H,(H4,15,16,20)(H4,17,18,21,22)

Standard InChI Key:  HNLGHUBITIGMQV-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   31.3944  -12.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3933  -13.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1013  -13.8619    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.8110  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8081  -12.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0995  -12.2245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5193  -13.8600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6852  -13.8610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5143  -12.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2235  -12.6245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.5112  -11.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.9297  -12.2132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6390  -12.6191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9266  -11.3960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6887  -12.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6907  -11.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2804  -12.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9858  -12.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2784  -11.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9834  -11.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.8132  -10.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.0031  -10.1192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.6726  -10.8636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  2  8  1  0
  5  9  1  0
  9 10  1  0
  9 11  2  0
 10 12  1  0
 12 13  1  0
 12 14  2  0
  1 15  1  0
 15 16  2  0
 16 20  1  0
 19 17  1  0
 17 18  2  0
 18 15  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4550786

    ---

Associated Targets(Human)

PLAU Tchem Urokinase-type plasminogen activator (2016 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 311.31Molecular Weight (Monoisotopic): 311.1131AlogP: 0.68#Rotatable Bonds: 2
Polar Surface Area: 169.93Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.86CX Basic pKa: 6.27CX LogP: 0.87CX LogD: 0.84
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.34Np Likeness Score: 0.01

References

1. Buckley BJ, Majed H, Aboelela A, Minaei E, Jiang L, Fildes K, Cheung CY, Johnson D, Bachovchin D, Cook GM, Huang M, Ranson M, Kelso MJ..  (2019)  6-Substituted amiloride derivatives as inhibitors of the urokinase-type plasminogen activator for use in metastatic disease.,  29  (24): [PMID:31679971] [10.1016/j.bmcl.2019.126753]

Source