The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((1H-Pyrrolo[2,3-b]pyridin-2-yl)methyl)-3-((6-(aminomethyl)pyrimidin-4-yl)oxy)benzamide hydrochloride ID: ALA4550837
PubChem CID: 135186022
Max Phase: Preclinical
Molecular Formula: C20H19ClN6O2
Molecular Weight: 374.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cl.NCc1cc(Oc2cccc(C(=O)NCc3cc4cccnc4[nH]3)c2)ncn1
Standard InChI: InChI=1S/C20H18N6O2.ClH/c21-10-15-9-18(25-12-24-15)28-17-5-1-3-14(8-17)20(27)23-11-16-7-13-4-2-6-22-19(13)26-16;/h1-9,12H,10-11,21H2,(H,22,26)(H,23,27);1H
Standard InChI Key: MYCTYIODBRWNFM-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
29.9063 -7.2777 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
23.8632 -8.4885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8580 -7.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5548 -7.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5494 -6.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8475 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1216 -6.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1270 -7.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2754 -6.0025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.2702 -5.1866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.5392 -4.7832 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5338 -3.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2597 -3.5256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9617 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.9670 -4.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6876 -3.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6824 -2.7006 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.1372 -8.9011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5651 -8.8920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.5705 -9.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3016 -10.1405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3942 -10.9559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1820 -11.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6146 -10.3944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4305 -10.3893 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8431 -11.1152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4395 -11.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6236 -11.8223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0570 -9.7860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
3 8 2 0
5 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
12 13 2 0
14 13 1 0
15 14 2 0
10 15 1 0
14 16 1 0
16 17 1 0
2 18 2 0
2 19 1 0
19 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 1 0
24 25 2 0
26 25 1 0
27 26 2 0
28 27 1 0
23 28 2 0
24 29 1 0
29 21 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.40Molecular Weight (Monoisotopic): 374.1491AlogP: 2.53#Rotatable Bonds: 6Polar Surface Area: 118.81Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.07CX LogP: 1.32CX LogD: 0.57Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -1.41
References 1. (2018) Lysyl oxidase-like 2 inhibitors and uses thereof,