(N-butyl-2-[2-methoxy-4-(4-oxo-3,4-dihydroquinazolin-2-yl)phenoxy]acetamide)

ID: ALA4550841

PubChem CID: 155554930

Max Phase: Preclinical

Molecular Formula: C21H23N3O4

Molecular Weight: 381.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCNC(=O)COc1ccc(-c2nc3ccccc3c(=O)[nH]2)cc1OC

Standard InChI:  InChI=1S/C21H23N3O4/c1-3-4-11-22-19(25)13-28-17-10-9-14(12-18(17)27-2)20-23-16-8-6-5-7-15(16)21(26)24-20/h5-10,12H,3-4,11,13H2,1-2H3,(H,22,25)(H,23,24,26)

Standard InChI Key:  ZDXXHGCGMOPSSA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   29.5784   -2.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5773   -3.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2853   -3.6718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.2835   -2.0344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9922   -2.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.9910   -3.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7011   -3.6762    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.4169   -3.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4181   -2.4417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.7034   -2.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1196   -3.6773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1160   -4.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8217   -4.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5315   -4.4995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5312   -3.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8249   -3.2712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7035   -1.2086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2386   -4.9091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9469   -4.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6540   -4.9112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3623   -4.5037    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.6528   -5.7284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0694   -4.9133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2386   -3.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9466   -3.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7778   -4.5058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4849   -4.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1932   -4.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
 10 17  2  0
 14 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 21 23  1  0
 15 24  1  0
 24 25  1  0
 23 26  1  0
 26 27  1  0
 27 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4550841

    ---

Associated Targets(Human)

CDK4 Tclin Cyclin-dependent kinase 4/cyclin D1 (2340 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 381.43Molecular Weight (Monoisotopic): 381.1689AlogP: 2.89#Rotatable Bonds: 8
Polar Surface Area: 93.31Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.96CX Basic pKa: 4.07CX LogP: 2.53CX LogD: 2.44
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.59Np Likeness Score: -1.11

References

1. Sonawane V, Mohd Siddique MU, Jadav SS, Sinha BN, Jayaprakash V, Chaudhuri B..  (2019)  Cink4T, a quinazolinone-based dual inhibitor of Cdk4 and tubulin polymerization, identified via ligand-based virtual screening, for efficient anticancer therapy.,  165  [PMID:30665142] [10.1016/j.ejmech.2019.01.011]

Source