The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(4-Cyanophenyl)-1-[4-(diethylamino)benzyl]-1-(5-methyl-3-phenylisoxazol-4-yl)urea ID: ALA4550877
PubChem CID: 155555066
Max Phase: Preclinical
Molecular Formula: C29H29N5O2
Molecular Weight: 479.58
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)c1ccc(CN(C(=O)Nc2ccc(C#N)cc2)c2c(-c3ccccc3)noc2C)cc1
Standard InChI: InChI=1S/C29H29N5O2/c1-4-33(5-2)26-17-13-23(14-18-26)20-34(29(35)31-25-15-11-22(19-30)12-16-25)28-21(3)36-32-27(28)24-9-7-6-8-10-24/h6-18H,4-5,20H2,1-3H3,(H,31,35)
Standard InChI Key: LERCBLOBIJOMQQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
14.8911 -4.4434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.8850 -5.2647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6639 -5.5249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1551 -4.8656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6738 -4.1991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8853 -3.4057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3035 -2.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5192 -2.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3129 -1.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8889 -2.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6821 -3.1933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9085 -6.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9723 -4.8717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3756 -5.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1928 -5.5885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5942 -6.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4106 -6.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8252 -5.6025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4175 -4.8894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6025 -4.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.6424 -5.6075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0467 -6.3177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0553 -4.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8725 -4.9073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8639 -6.3227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3861 -4.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9828 -3.4563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.2033 -4.1731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6171 -3.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4338 -3.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8475 -2.7727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4442 -2.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6228 -2.0575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2127 -2.7619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8585 -1.3579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.2714 -0.6598 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 1 2 0
6 5 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
3 12 1 0
4 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 15 1 0
18 21 1 0
21 22 1 0
21 23 1 0
23 24 1 0
22 25 1 0
13 26 1 0
26 27 2 0
26 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
35 36 3 0
32 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 479.58Molecular Weight (Monoisotopic): 479.2321AlogP: 6.61#Rotatable Bonds: 8Polar Surface Area: 85.40Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.50CX Basic pKa: 5.69CX LogP: 5.98CX LogD: 5.97Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.31Np Likeness Score: -1.76
References 1. Jumppanen M, Kinnunen SM, Välimäki MJ, Talman V, Auno S, Bruun T, Boije Af Gennäs G, Xhaard H, Aumüller IB, Ruskoaho H, Yli-Kauhaluoma J.. (2019) Synthesis, Identification, and Structure-Activity Relationship Analysis of GATA4 and NKX2-5 Protein-Protein Interaction Modulators., 62 (17): [PMID:31431011 ] [10.1021/acs.jmedchem.9b01086 ]