The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S,6S)-3,6-Bis((R)-1-(benzyloxy)ethyl)piperazine-2,5-dione ID: ALA4551241
PubChem CID: 155554970
Max Phase: Preclinical
Molecular Formula: C22H26N2O4
Molecular Weight: 382.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CC(OCc1ccccc1)[C@@H]1NC(=O)[C@H](C(C)OCc2ccccc2)NC1=O
Standard InChI: InChI=1S/C22H26N2O4/c1-15(27-13-17-9-5-3-6-10-17)19-21(25)24-20(22(26)23-19)16(2)28-14-18-11-7-4-8-12-18/h3-12,15-16,19-20H,13-14H2,1-2H3,(H,23,26)(H,24,25)/t15?,16?,19-,20-/m0/s1
Standard InChI Key: TXQSDLJZBRRPJC-PNGKTBNWSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
25.1678 -21.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1678 -22.7204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8731 -23.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5784 -22.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5784 -21.9032 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8731 -21.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8731 -20.6733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.8731 -23.9421 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.2855 -23.1300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4589 -21.4967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.9938 -22.7224 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.7524 -21.9073 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.0435 -21.5008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3370 -21.9115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6288 -21.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9228 -21.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9248 -22.7297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6386 -23.1361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3417 -22.7237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7009 -23.1321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4092 -22.7245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1166 -23.1358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8244 -22.7290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8260 -21.9109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1140 -21.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4091 -21.9107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4565 -20.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2843 -23.9472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
3 8 2 0
4 9 1 1
1 10 1 1
9 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
11 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
10 27 1 0
9 28 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.46Molecular Weight (Monoisotopic): 382.1893AlogP: 2.18#Rotatable Bonds: 8Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.67CX Basic pKa: ┄CX LogP: 2.40CX LogD: 2.40Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.73Np Likeness Score: 0.31
References 1. Simon G, Bérubé C, Voyer N, Grenier D.. (2019) Anti-biofilm and anti-adherence properties of novel cyclic dipeptides against oral pathogens., 27 (12): [PMID:30528685 ] [10.1016/j.bmc.2018.11.042 ]