8-cyclopropyl-6-(2,6-dichlorophenyl)-2-(4-(4-methylpiperazin-1-yl)phenylamino)pyrido[2,3-d]pyrimidin-5(8H)-one

ID: ALA4551299

PubChem CID: 71555194

Max Phase: Preclinical

Molecular Formula: C27H26Cl2N6O

Molecular Weight: 521.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1CCN(c2ccc(Nc3ncc4c(=O)c(-c5c(Cl)cccc5Cl)cn(C5CC5)c4n3)cc2)CC1

Standard InChI:  InChI=1S/C27H26Cl2N6O/c1-33-11-13-34(14-12-33)18-7-5-17(6-8-18)31-27-30-15-20-25(36)21(24-22(28)3-2-4-23(24)29)16-35(19-9-10-19)26(20)32-27/h2-8,15-16,19H,9-14H2,1H3,(H,30,31,32)

Standard InChI Key:  PUGODERXIRVRTM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   26.3854   -2.8726    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.0943   -3.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0927   -4.1007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7969   -4.5079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5032   -4.1010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5009   -3.2825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7961   -2.8789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2113   -4.5089    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9186   -4.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.6251   -4.5101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.6184   -2.8757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9145   -3.2866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.3315   -3.2834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.3296   -4.1026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7471   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0380   -2.8732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7740   -4.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0348   -4.5065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.0388   -2.0560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4489   -2.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1578   -3.2691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8591   -2.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8479   -2.0332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1294   -1.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4311   -2.0553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7153   -1.6609    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   34.1670   -4.0863    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   26.3903   -2.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6855   -1.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9712   -2.0428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.9662   -2.8640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6756   -3.2812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2665   -1.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.0252   -5.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.6129   -6.0267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4300   -6.0363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 14  1  0
 13 11  1  0
 11 12  2  0
 12  9  1  0
 13 14  2  0
 13 16  1  0
 14 18  1  0
 17 15  2  0
 15 16  1  0
 17 18  1  0
 16 19  2  0
 15 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 25 26  1  0
 21 27  1  0
  1 28  1  0
  1 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  1  0
 18 34  1  0
 35 34  1  0
 36 35  1  0
 34 36  1  0
M  END

Associated Targets(Human)

WEE1 Tchem Serine/threonine-protein kinase WEE1 (1772 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H1299 (3248 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 521.45Molecular Weight (Monoisotopic): 520.1545AlogP: 5.60#Rotatable Bonds: 5
Polar Surface Area: 66.29Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.96CX LogP: 5.87CX LogD: 5.21
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.13

References

1. Mastracchio A, Lai C, Torrent M, Bromberg K, Buchanan FG, Ferguson D, Bontcheva V, Johnson EF, Lasko L, Maag D, Shoemaker AR, Penning TD..  (2019)  Investigation of biaryl heterocycles as inhibitors of Wee1 kinase.,  29  (12): [PMID:31014911] [10.1016/j.bmcl.2019.04.017]

Source