The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-cyclopropyl-6-(2,6-dichlorophenyl)-2-(4-(4-methylpiperazin-1-yl)phenylamino)pyrido[2,3-d]pyrimidin-5(8H)-one ID: ALA4551299
PubChem CID: 71555194
Max Phase: Preclinical
Molecular Formula: C27H26Cl2N6O
Molecular Weight: 521.45
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(c2ccc(Nc3ncc4c(=O)c(-c5c(Cl)cccc5Cl)cn(C5CC5)c4n3)cc2)CC1
Standard InChI: InChI=1S/C27H26Cl2N6O/c1-33-11-13-34(14-12-33)18-7-5-17(6-8-18)31-27-30-15-20-25(36)21(24-22(28)3-2-4-23(24)29)16-35(19-9-10-19)26(20)32-27/h2-8,15-16,19H,9-14H2,1H3,(H,30,31,32)
Standard InChI Key: PUGODERXIRVRTM-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 41 0 0 0 0 0 0 0 0999 V2000
26.3854 -2.8726 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0943 -3.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0927 -4.1007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7969 -4.5079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5032 -4.1010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.5009 -3.2825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7961 -2.8789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2113 -4.5089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.9186 -4.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.6251 -4.5101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.6184 -2.8757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.9145 -3.2866 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.3315 -3.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.3296 -4.1026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7471 -3.2867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0380 -2.8732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7740 -4.1059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0348 -4.5065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.0388 -2.0560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.4489 -2.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1578 -3.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8591 -2.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8479 -2.0332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.1294 -1.6350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.4311 -2.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7153 -1.6609 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
34.1670 -4.0863 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
26.3903 -2.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6855 -1.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.9712 -2.0428 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9662 -2.8640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6756 -3.2812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2665 -1.6289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0252 -5.3237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6129 -6.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4300 -6.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 14 1 0
13 11 1 0
11 12 2 0
12 9 1 0
13 14 2 0
13 16 1 0
14 18 1 0
17 15 2 0
15 16 1 0
17 18 1 0
16 19 2 0
15 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
25 26 1 0
21 27 1 0
1 28 1 0
1 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
30 33 1 0
18 34 1 0
35 34 1 0
36 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.45Molecular Weight (Monoisotopic): 520.1545AlogP: 5.60#Rotatable Bonds: 5Polar Surface Area: 66.29Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.96CX LogP: 5.87CX LogD: 5.21Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.13
References 1. Mastracchio A, Lai C, Torrent M, Bromberg K, Buchanan FG, Ferguson D, Bontcheva V, Johnson EF, Lasko L, Maag D, Shoemaker AR, Penning TD.. (2019) Investigation of biaryl heterocycles as inhibitors of Wee1 kinase., 29 (12): [PMID:31014911 ] [10.1016/j.bmcl.2019.04.017 ]