The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((2-Fluorobenzyl)thio)-4-((4-(trifluoromethyl)benzyl)thio)-1,3,5-triazin-2(1H)-one ID: ALA4551375
PubChem CID: 155554872
Max Phase: Preclinical
Molecular Formula: C18H13F4N3OS2
Molecular Weight: 427.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: O=c1nc(SCc2ccc(C(F)(F)F)cc2)nc(SCc2ccccc2F)[nH]1
Standard InChI: InChI=1S/C18H13F4N3OS2/c19-14-4-2-1-3-12(14)10-28-17-24-15(26)23-16(25-17)27-9-11-5-7-13(8-6-11)18(20,21)22/h1-8H,9-10H2,(H,23,24,25,26)
Standard InChI Key: IBDHTKQKRGIOSQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
31.8649 -20.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8638 -21.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5718 -21.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2815 -21.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2786 -20.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5700 -19.8764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9898 -21.5118 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
33.9848 -19.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9817 -19.0532 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.6879 -18.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3923 -19.0507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.0963 -18.6430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0975 -17.8254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3884 -17.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.6782 -17.8268 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
36.8040 -19.0516 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.8040 -19.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3881 -16.6001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.5117 -20.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.5096 -21.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2165 -21.5039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9252 -21.0952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9226 -20.2738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2151 -19.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6334 -21.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.6345 -22.3201 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.3406 -21.0934 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
40.3354 -21.9115 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
5 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
10 15 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 1 0
12 16 1 0
16 17 1 0
14 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.45Molecular Weight (Monoisotopic): 427.0436AlogP: 4.91#Rotatable Bonds: 6Polar Surface Area: 58.64Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.53CX Basic pKa: ┄CX LogP: 5.83CX LogD: 4.93Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.45Np Likeness Score: -1.82
References 1. Bergant K, Janežič M, Valjavec K, Sosič I, Pajk S, Štampar M, Žegura B, Gobec S, Filipič M, Perdih A.. (2019) Structure-guided optimization of 4,6-substituted-1,3,5-triazin-2(1H)-ones as catalytic inhibitors of human DNA topoisomerase IIα., 175 [PMID:31096154 ] [10.1016/j.ejmech.2019.04.055 ]