Benzyl ((2S)-1-(((2S)-1-(((3S)-2-hydroxy-1-(isobutylamino)-5-methyl-1-oxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate

ID: ALA4551392

PubChem CID: 155554982

Max Phase: Preclinical

Molecular Formula: C31H52N4O6

Molecular Weight: 576.78

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CNC(=O)C(O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C31H52N4O6/c1-19(2)14-24(27(36)30(39)32-17-22(7)8)33-28(37)25(15-20(3)4)34-29(38)26(16-21(5)6)35-31(40)41-18-23-12-10-9-11-13-23/h9-13,19-22,24-27,36H,14-18H2,1-8H3,(H,32,39)(H,33,37)(H,34,38)(H,35,40)/t24-,25-,26-,27?/m0/s1

Standard InChI Key:  YYQUWEHDGMSSOG-QPWGPPCNSA-N

Molfile:  

 
     RDKit          2D

 41 41  0  0  0  0  0  0  0  0999 V2000
    4.4917   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2062   -3.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7772   -3.3959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4917   -4.6334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7772   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627   -2.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0657   -1.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3521   -0.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6366   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6393   -2.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3535   -2.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9207   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6351   -3.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3496   -3.8084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6351   -2.5708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9207   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6302   -5.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6303   -5.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3446   -4.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0641   -3.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7785   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0641   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7792   -2.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4971   -2.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7723   -1.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7785   -4.6334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4930   -3.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -3.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -2.1583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075   -2.1583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -5.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -5.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -3.8084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3509   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0654   -2.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7799   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0654   -1.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 12 16  1  6
 16 17  1  0
 17 18  1  0
 17 19  1  0
 14 20  1  0
 20 21  1  0
 20 22  1  1
 22 23  1  0
 23 24  1  0
 23 25  1  0
 21 26  2  0
 21 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  6
 29 31  1  0
 31 32  1  0
 31 33  2  0
 30 34  1  0
 34 35  1  0
 34 36  1  0
 29 37  1  0
 32 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551392

    ---

Associated Targets(Human)

PSMB1 Tclin Proteasome component C5 (935 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB2 Tclin Proteasome Macropain subunit (1025 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PSMB5 Tclin Proteasome Macropain subunit MB1 (2451 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 576.78Molecular Weight (Monoisotopic): 576.3887AlogP: 3.52#Rotatable Bonds: 17
Polar Surface Area: 145.86Molecular Species: NEUTRALHBA: 6HBD: 5
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.23CX Basic pKa: CX LogP: 4.30CX LogD: 4.30
Aromatic Rings: 1Heavy Atoms: 41QED Weighted: 0.19Np Likeness Score: -0.03

References

1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M..  (2019)  Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors.,  10  (7): [PMID:31312413] [10.1021/acsmedchemlett.9b00233]

Source