Benzyl ((2S)-1-(((2S)-1-(((3S)-2-hydroxy-1-(isobutylamino)-5-methyl-1-oxohexan-3-yl)amino)-4-methyl-1-oxopentan-2-yl)amino)-4-methyl-1-oxopentan-2-yl)carbamate

ID: ALA4551392

PubChem CID: 155554982

Max Phase: Preclinical

Molecular Formula: C31H52N4O6

Molecular Weight: 576.78

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CC(C)CNC(=O)C(O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C31H52N4O6/c1-19(2)14-24(27(36)30(39)32-17-22(7)8)33-28(37)25(15-20(3)4)34-29(38)26(16-21(5)6)35-31(40)41-18-23-12-10-9-11-13-23/h9-13,19-22,24-27,36H,14-18H2,1-8H3,(H,32,39)(H,33,37)(H,34,38)(H,35,40)/t24-,25-,26-,27?/m0/s1

Standard InChI Key:  YYQUWEHDGMSSOG-QPWGPPCNSA-N

Molfile:  

 
     RDKit          2D

 41 41  0  0  0  0  0  0  0  0999 V2000
    4.4917   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2062   -3.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7772   -3.3959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4917   -4.6334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7772   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627   -2.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0657   -1.3322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3521   -0.9198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6366   -1.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6393   -2.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3535   -2.5703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9207   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6351   -3.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3496   -3.8084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6351   -2.5708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9207   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6302   -5.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6303   -5.8678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3446   -4.6302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0641   -3.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7785   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0641   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7792   -2.1499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4971   -2.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7723   -1.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7785   -4.6334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4930   -3.3959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075   -3.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -3.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -2.1583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.2075   -2.1583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -5.0459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9219   -5.8709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -4.6334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364   -3.8084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3509   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0654   -2.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7799   -2.5708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0654   -1.3333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 12 16  1  6
 16 17  1  0
 17 18  1  0
 17 19  1  0
 14 20  1  0
 20 21  1  0
 20 22  1  1
 22 23  1  0
 23 24  1  0
 23 25  1  0
 21 26  2  0
 21 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  6
 29 31  1  0
 31 32  1  0
 31 33  2  0
 30 34  1  0
 34 35  1  0
 34 36  1  0
 29 37  1  0
 32 38  1  0
 38 39  1  0
 39 40  1  0
 39 41  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4551392

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 576.78

Molecular Weight (Monoisotopic): 576.3887

AlogP: 3.52

#Rotatable Bonds: 17

Polar Surface Area: 145.86

Molecular Species: NEUTRAL

HBA: 6

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 10

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 12.23

CX Basic pKa: ┄

CX LogP: 4.30

CX LogD: 4.30

Aromatic Rings: 1

Heavy Atoms: 41

QED Weighted: 0.19

Np Likeness Score: -0.03

References

1. Pacifico S, Ferretti V, Albanese V, Fantinati A, Gallerani E, Nicoli F, Gavioli R, Zamberlan F, Preti D, Marastoni M..  (2019)  Synthesis and Biological Activity of Peptide α-Ketoamide Derivatives as Proteasome Inhibitors.,  10  (7): [PMID:31312413] [10.1021/acsmedchemlett.9b00233]

Source

Source(1):

• Scientific Literature