The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N3-(3-ethynylphenyl)-N2-(4-methoxyphenyl)-6-nitroquinoxaline-2,3-diamine ID: ALA4551394
PubChem CID: 130230866
Max Phase: Preclinical
Molecular Formula: C23H17N5O3
Molecular Weight: 411.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C#Cc1cccc(Nc2nc3cc([N+](=O)[O-])ccc3nc2Nc2ccc(OC)cc2)c1
Standard InChI: InChI=1S/C23H17N5O3/c1-3-15-5-4-6-17(13-15)25-23-22(24-16-7-10-19(31-2)11-8-16)26-20-12-9-18(28(29)30)14-21(20)27-23/h1,4-14H,2H3,(H,24,26)(H,25,27)
Standard InChI Key: UUCUXKYURZHXPB-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
19.7647 -24.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8916 -22.0346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3343 -24.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7395 -20.7908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.0526 -23.2788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0549 -22.4547 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3494 -19.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3354 -22.0366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0473 -24.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7638 -23.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0582 -20.7868 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7763 -19.5577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6130 -20.7800 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0259 -21.2030 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.4534 -21.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0654 -18.3197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3367 -21.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7786 -18.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8928 -21.1990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7393 -19.9666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.0602 -19.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4522 -22.0371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3369 -23.6871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1714 -20.7864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1732 -22.4535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6106 -22.4511 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4936 -18.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3482 -18.7344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2025 -17.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0461 -25.7426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.3378 -26.1501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 21 1 0
12 18 1 0
3 9 2 0
17 11 1 0
17 13 2 0
6 5 1 0
19 2 1 0
24 15 1 0
5 23 2 0
21 12 2 0
18 16 2 0
18 27 1 0
2 26 1 0
10 5 1 0
26 8 2 0
4 14 2 0
16 28 1 0
9 1 1 0
23 3 1 0
19 24 2 0
19 13 1 0
11 21 1 0
1 10 2 0
8 6 1 0
15 22 2 0
25 2 2 0
8 17 1 0
15 4 1 0
22 25 1 0
4 20 1 0
28 7 2 0
27 29 3 0
9 30 1 0
30 31 1 0
M CHG 2 4 1 20 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 411.42Molecular Weight (Monoisotopic): 411.1331AlogP: 5.02#Rotatable Bonds: 6Polar Surface Area: 102.21Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.97CX Basic pKa: 0.94CX LogP: 5.30CX LogD: 5.30Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.26Np Likeness Score: -1.54
References 1. (2017) Aryl amine substituted quinoxaline used as anticancer drugs,