The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl)-4-(trifluoromethoxy)phenyl)morpholine ID: ALA4551424
PubChem CID: 155555306
Max Phase: Preclinical
Molecular Formula: C21H20F3N3O5
Molecular Weight: 451.40
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3N3CCOCC3)o2)cc1OC
Standard InChI: InChI=1S/C21H20F3N3O5/c1-28-17-6-3-13(11-18(17)29-2)19-25-26-20(31-19)15-12-14(32-21(22,23)24)4-5-16(15)27-7-9-30-10-8-27/h3-6,11-12H,7-10H2,1-2H3
Standard InChI Key: ZZJMPYZXFFRHBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
36.4420 -27.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4409 -27.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1489 -28.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8586 -27.8441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8557 -27.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1471 -26.6162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1447 -25.7990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8512 -25.3883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8487 -24.5711 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.5601 -25.7948 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
38.5566 -24.9739 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
37.1487 -29.0707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
38.5669 -28.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6542 -29.0618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4538 -29.2304 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.8613 -28.5220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.3134 -27.9157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.6780 -28.5191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0869 -29.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.9029 -29.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.3096 -28.5156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.8943 -27.8074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.0798 -27.8134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.1267 -28.5116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.5388 -29.2173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2980 -27.0968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
43.1151 -27.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4396 -29.4730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.4375 -30.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.1433 -30.6992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.8529 -30.2920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8567 -29.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
6 7 1 0
7 8 1 0
8 9 1 0
8 10 1 0
8 11 1 0
3 12 1 0
4 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 13 1 0
16 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
21 24 1 0
24 25 1 0
22 26 1 0
26 27 1 0
12 28 1 0
12 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.40Molecular Weight (Monoisotopic): 451.1355AlogP: 4.16#Rotatable Bonds: 6Polar Surface Area: 79.08Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.01CX LogD: 4.01Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.08
References 1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW.. (2019) Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278., 29 (10): [PMID:30910459 ] [10.1016/j.bmcl.2019.03.016 ]