4-(2-(5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl)-4-(trifluoromethoxy)phenyl)morpholine

ID: ALA4551424

PubChem CID: 155555306

Max Phase: Preclinical

Molecular Formula: C21H20F3N3O5

Molecular Weight: 451.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3N3CCOCC3)o2)cc1OC

Standard InChI:  InChI=1S/C21H20F3N3O5/c1-28-17-6-3-13(11-18(17)29-2)19-25-26-20(31-19)15-12-14(32-21(22,23)24)4-5-16(15)27-7-9-30-10-8-27/h3-6,11-12H,7-10H2,1-2H3

Standard InChI Key:  ZZJMPYZXFFRHBS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   36.4420  -27.0251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4409  -27.8446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1489  -28.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8586  -27.8441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8557  -27.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1471  -26.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1447  -25.7990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8512  -25.3883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8487  -24.5711    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5601  -25.7948    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   38.5566  -24.9739    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   37.1487  -29.0707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.5669  -28.2516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.6542  -29.0618    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.4538  -29.2304    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.8613  -28.5220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.3134  -27.9157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.6780  -28.5191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0869  -29.2273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9029  -29.2248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3096  -28.5156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.8943  -27.8074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0798  -27.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.1267  -28.5116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.5388  -29.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2980  -27.0968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.1151  -27.0911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4396  -29.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4375  -30.2866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1433  -30.6992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.8529  -30.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8567  -29.4722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  3 12  1  0
  4 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 13  1  0
 16 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 21 24  1  0
 24 25  1  0
 22 26  1  0
 26 27  1  0
 12 28  1  0
 12 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551424

    ---

Associated Targets(non-human)

Grm7 Metabotropic glutamate receptor 7 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.40Molecular Weight (Monoisotopic): 451.1355AlogP: 4.16#Rotatable Bonds: 6
Polar Surface Area: 79.08Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.01CX LogD: 4.01
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.08

References

1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW..  (2019)  Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278.,  29  (10): [PMID:30910459] [10.1016/j.bmcl.2019.03.016]

Source