2-(3,4-dimethoxyphenyl)-5-(2-(pyridin-3-yl)-5-(trifluoromethoxy)phenyl)-1,3,4-oxadiazole

ID: ALA4551426

PubChem CID: 155555308

Max Phase: Preclinical

Molecular Formula: C22H16F3N3O4

Molecular Weight: 443.38

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3-c3cccnc3)o2)cc1OC

Standard InChI:  InChI=1S/C22H16F3N3O4/c1-29-18-8-5-13(10-19(18)30-2)20-27-28-21(31-20)17-11-15(32-22(23,24)25)6-7-16(17)14-4-3-9-26-12-14/h3-12H,1-2H3

Standard InChI Key:  UAXDEWNGWUVQAX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   32.8720   -3.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8708   -4.7610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5789   -5.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2885   -4.7605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2857   -3.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5771   -3.5326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5746   -2.7154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2811   -2.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2787   -1.4875    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.9900   -2.7112    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.9865   -1.8903    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   34.9969   -5.1680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0841   -5.9782    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8837   -6.1468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.2912   -5.4384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7434   -4.8321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1079   -5.4356    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5169   -6.1437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3328   -6.1412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7395   -5.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3243   -4.7238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.5097   -4.7298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5567   -5.4280    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.9687   -6.1337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7279   -4.0132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.5451   -4.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5787   -5.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8711   -6.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8706   -7.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5787   -7.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2889   -7.2060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2859   -6.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
  8 11  1  0
  4 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 20 23  1  0
 23 24  1  0
 21 25  1  0
 25 26  1  0
  3 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551426

    ---

Associated Targets(non-human)

Grm7 Metabotropic glutamate receptor 7 (580 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 443.38Molecular Weight (Monoisotopic): 443.1093AlogP: 5.38#Rotatable Bonds: 6
Polar Surface Area: 79.50Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.64CX LogP: 4.55CX LogD: 4.55
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.83

References

1. Reed CW, Washecheck JP, Quitlag MC, Jenkins MT, Rodriguez AL, Engers DW, Blobaum AL, Conn PJ, Niswender CM, Lindsley CW..  (2019)  Surveying heterocycles as amide bioisosteres within a series of mGlu7 NAMs: Discovery of VU6019278.,  29  (10): [PMID:30910459] [10.1016/j.bmcl.2019.03.016]

Source