The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-((2-(cyclopropanecarboxamido)pyridin-4-yl)oxy)-2,3-dimethylphenyl)-1-(4-fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxamide ID: ALA4551490
PubChem CID: 138393291
Product Number: R613202, Order Now?
Max Phase: Preclinical
Molecular Formula: C29H25FN4O4
Molecular Weight: 512.54
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(NC(=O)c2cccn(-c3ccc(F)cc3)c2=O)ccc(Oc2ccnc(NC(=O)C3CC3)c2)c1C
Standard InChI: InChI=1S/C29H25FN4O4/c1-17-18(2)25(38-22-13-14-31-26(16-22)33-27(35)19-5-6-19)12-11-24(17)32-28(36)23-4-3-15-34(29(23)37)21-9-7-20(30)8-10-21/h3-4,7-16,19H,5-6H2,1-2H3,(H,32,36)(H,31,33,35)
Standard InChI Key: PETCZXAONWLUFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
11.2464 -10.5416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9544 -10.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6586 -10.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6586 -11.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9569 -11.7670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2464 -11.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5342 -11.7734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5342 -12.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2463 -13.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2452 -13.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5327 -14.2287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.8285 -13.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8259 -13.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1205 -14.2336 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4083 -13.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7002 -14.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8827 -14.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2914 -14.9410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4083 -13.0023 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3708 -10.1334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3708 -9.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0788 -8.9062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0788 -8.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7869 -7.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4949 -8.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4950 -8.9063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7869 -9.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7869 -10.1334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2072 -9.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9155 -8.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6199 -9.3134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6199 -10.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9180 -10.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2072 -10.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3321 -10.5408 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.6586 -8.9062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9544 -9.3149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5381 -10.1349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
12 14 1 0
14 15 1 0
15 16 1 0
17 16 1 0
17 18 1 0
16 18 1 0
15 19 2 0
3 20 1 0
20 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 1 0
22 27 1 0
27 28 2 0
29 26 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
32 35 1 0
21 36 2 0
2 37 1 0
1 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.54Molecular Weight (Monoisotopic): 512.1860AlogP: 5.38#Rotatable Bonds: 7Polar Surface Area: 102.32Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.90CX Basic pKa: 4.91CX LogP: 4.98CX LogD: 4.98Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.35Np Likeness Score: -1.64
References 1. Hart AC, Abell L, Guo J, Mertzman ME, Padmanabha R, Macor JE, Chaudhry C, Lu H, O'Malley K, Shaw PJ, Weigelt C, Pokross M, Kish K, Kim KS, Cornelius L, Douglas AE, Calambur D, Zhang P, Carpenter B, Pitts WJ.. (2020) Identification of RIPK3 Type II Inhibitors Using High-Throughput Mechanistic Studies in Hit Triage., 11 (3): [PMID:32184955 ] [10.1021/acsmedchemlett.9b00065 ] 2. EUbOPEN. (2023) EUbOPEN Chemogenomics Library - IncuCyte, [10.6019/CHEMBL5303304 ]