1-((5-Bromo-4-((4-bromonaphth-1-yl)methyl)-4H-1,2,4-triazol-3-yl)thio)-N-(4-iodopyridin-3-yl)methanesulfonamide

ID: ALA4551589

PubChem CID: 155555487

Max Phase: Preclinical

Molecular Formula: C19H14Br2IN5O2S2

Molecular Weight: 695.20

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=S(=O)(CSc1nnc(Br)n1Cc1ccc(Br)c2ccccc12)Nc1cnccc1I

Standard InChI:  InChI=1S/C19H14Br2IN5O2S2/c20-15-6-5-12(13-3-1-2-4-14(13)15)10-27-18(21)24-25-19(27)30-11-31(28,29)26-17-9-23-8-7-16(17)22/h1-9,26H,10-11H2

Standard InChI Key:  RIXHGELNFVEMJH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   15.4523   -3.3472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8651   -4.0571    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   16.2735   -3.3447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.5395   -6.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8261   -6.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8257   -7.7607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5381   -8.1701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2491   -6.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2517   -7.7533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9544   -8.1549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6591   -7.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6527   -6.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9453   -6.5259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5395   -5.7067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8277   -5.2981    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7393   -4.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9358   -4.3133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5231   -5.0252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.0741   -5.6324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4453   -4.0653    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.1608   -4.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9045   -6.4359    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   14.5410   -8.9914    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   16.5762   -4.4614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.2812   -4.0481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9880   -4.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6925   -4.0410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6875   -3.2229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9721   -2.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2705   -3.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5581   -2.8340    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  9  1  0
  8  4  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13  8  2  0
  4 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 16 20  1  0
 20 21  1  0
 19 22  1  0
  7 23  1  0
 21  2  1  0
  2 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551589

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 695.20Molecular Weight (Monoisotopic): 692.8000AlogP: 5.50#Rotatable Bonds: 7
Polar Surface Area: 89.77Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.32CX Basic pKa: 2.23CX LogP: 4.66CX LogD: 4.66
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.20Np Likeness Score: -1.65

References

1. Wu JW, Yin L, Liu YQ, Zhang H, Xie YF, Wang RL, Zhao GL..  (2019)  Synthesis, biological evaluation and 3D-QSAR studies of 1,2,4-triazole-5-substituted carboxylic acid bioisosteres as uric acid transporter 1 (URAT1) inhibitors for the treatment of hyperuricemia associated with gout.,  29  (3): [PMID:30579795] [10.1016/j.bmcl.2018.12.036]

Source