The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-Bromobenzamido)-6-((2-(trifluoromethyl)phenyl)carbamothioyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide ID: ALA4551692
PubChem CID: 155555594
Max Phase: Preclinical
Molecular Formula: C23H18BrF3N4O2S2
Molecular Weight: 583.46
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2ccccc2Br)sc2c1CCN(C(=S)Nc1ccccc1C(F)(F)F)C2
Standard InChI: InChI=1S/C23H18BrF3N4O2S2/c24-15-7-3-1-5-12(15)20(33)30-21-18(19(28)32)13-9-10-31(11-17(13)35-21)22(34)29-16-8-4-2-6-14(16)23(25,26)27/h1-8H,9-11H2,(H2,28,32)(H,29,34)(H,30,33)
Standard InChI Key: HYFYLIPYCCETAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
31.7714 -2.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7714 -3.2110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.4808 -3.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4808 -1.9728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1902 -2.3897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1947 -3.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9740 -3.4547 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.4487 -2.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.9668 -2.1341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2700 -2.7851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.6867 -3.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5080 -3.4902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2779 -4.2088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2151 -1.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6608 -0.7430 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0176 -1.1729 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.0648 -3.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9171 -4.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7376 -4.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1452 -3.4823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.7262 -2.7710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9070 -2.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3560 -3.2148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.6494 -3.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9421 -3.2171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2360 -3.6269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2378 -4.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9516 -4.8515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6548 -4.4393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0670 -4.4387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
36.4907 -2.0754 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
28.9412 -2.3999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6484 -1.9904 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.2330 -1.9921 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.9360 -1.5807 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 2 0
14 16 1 0
2 17 1 0
12 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 12 1 0
17 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
17 30 2 0
22 31 1 0
25 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.46Molecular Weight (Monoisotopic): 582.0007AlogP: 5.64#Rotatable Bonds: 4Polar Surface Area: 87.46Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.46CX Basic pKa: ┄CX LogP: 6.30CX LogD: 6.30Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -2.13
References 1. Wang G, Zhao Y, Liu Y, Sun D, Zhen Y, Liu J, Fu L, Zhang L, Ouyang L.. (2020) Discovery of a Novel Dual-Target Inhibitor of ERK1 and ERK5 That Induces Regulated Cell Death to Overcome Compensatory Mechanism in Specific Tumor Types., 63 (8): [PMID:32078308 ] [10.1021/acs.jmedchem.9b01896 ]