The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-(3-Chlorobenzyl)-2-(2-fluorobenzamido)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide ID: ALA4551716
PubChem CID: 155555709
Max Phase: Preclinical
Molecular Formula: C22H19ClFN3O2S
Molecular Weight: 443.93
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)c1c(NC(=O)c2ccccc2F)sc2c1CCN(Cc1cccc(Cl)c1)C2
Standard InChI: InChI=1S/C22H19ClFN3O2S/c23-14-5-3-4-13(10-14)11-27-9-8-16-18(12-27)30-22(19(16)20(25)28)26-21(29)15-6-1-2-7-17(15)24/h1-7,10H,8-9,11-12H2,(H2,25,28)(H,26,29)
Standard InChI Key: CCPBUPUGQWXMOS-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
31.8498 -2.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.8498 -3.4297 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.5592 -3.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.5592 -2.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2686 -2.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.2731 -3.4262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0524 -3.6734 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
34.5272 -3.0084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.0452 -2.3528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3485 -3.0038 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.7651 -3.7134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5864 -3.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3563 -4.4275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.2935 -1.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7392 -0.9617 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.0960 -1.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.1432 -3.8402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4344 -3.4336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.4352 -2.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7272 -2.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0196 -2.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.0245 -3.4445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.7330 -3.8474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9955 -4.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8160 -4.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.2236 -3.7010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.8046 -2.9897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.9854 -2.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5691 -2.2942 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
29.7254 -1.3953 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
8 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
9 14 1 0
14 15 2 0
14 16 1 0
2 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
12 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 12 1 0
28 29 1 0
20 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.93Molecular Weight (Monoisotopic): 443.0871AlogP: 4.45#Rotatable Bonds: 5Polar Surface Area: 75.43Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.66CX Basic pKa: 5.92CX LogP: 5.10CX LogD: 5.08Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -2.46
References 1. Wang G, Zhao Y, Liu Y, Sun D, Zhen Y, Liu J, Fu L, Zhang L, Ouyang L.. (2020) Discovery of a Novel Dual-Target Inhibitor of ERK1 and ERK5 That Induces Regulated Cell Death to Overcome Compensatory Mechanism in Specific Tumor Types., 63 (8): [PMID:32078308 ] [10.1021/acs.jmedchem.9b01896 ]