Methyl (2R/S,4S)-2-Cyano-4-((S)-3-(4-fluorophenyl)-2-(5-methylisoxazole-3-carboxamido)propanamido)-5-((S)-2-oxopiperidin-3-yl)pentanoate

ID: ALA4551761

PubChem CID: 155555905

Max Phase: Preclinical

Molecular Formula: C26H30FN5O6

Molecular Weight: 527.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C(C#N)C[C@H](C[C@@H]1CCCNC1=O)NC(=O)[C@H](Cc1ccc(F)cc1)NC(=O)c1cc(C)on1

Standard InChI:  InChI=1S/C26H30FN5O6/c1-15-10-22(32-38-15)25(35)31-21(11-16-5-7-19(27)8-6-16)24(34)30-20(13-18(14-28)26(36)37-2)12-17-4-3-9-29-23(17)33/h5-8,10,17-18,20-21H,3-4,9,11-13H2,1-2H3,(H,29,33)(H,30,34)(H,31,35)/t17-,18?,20-,21-/m0/s1

Standard InChI Key:  JSDJCPIMQDXVFT-DVMLBRBMSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    5.7215  -24.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4339  -23.6075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0091  -23.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7215  -24.8392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1505  -24.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8629  -23.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5753  -24.0153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1505  -24.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8629  -25.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8583  -26.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5699  -26.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2875  -26.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2848  -25.2520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5685  -24.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0004  -26.4870    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.2919  -23.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0043  -24.0153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7167  -23.6075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9218  -22.7860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1162  -22.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7042  -23.3254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2570  -23.9354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7818  -21.8610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4325  -24.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2919  -22.4263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5711  -22.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5738  -21.1852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8581  -20.7690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1404  -21.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1432  -22.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8595  -22.4258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2912  -20.7703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8629  -22.7793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.7137  -22.7787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7152  -21.9464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4325  -24.8531    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1533  -23.6046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8741  -24.0208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  1  4  2  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  5  8  1  6
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 12 15  1  0
 16  7  1  1
 16 17  1  0
 17 18  1  0
  3 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22  3  2  0
 20 23  1  0
 18 24  1  0
 16 25  1  0
 26 25  1  6
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 26 31  1  0
 27 32  2  0
  6 33  2  0
 34 35  3  0
 18 34  1  0
 24 36  2  0
 24 37  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551761

    ---

Associated Targets(Human)

RD (1212 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Enterovirus A71 (1246 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.55Molecular Weight (Monoisotopic): 527.2180AlogP: 1.57#Rotatable Bonds: 11
Polar Surface Area: 163.42Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.13CX Basic pKa: CX LogP: 1.20CX LogD: 1.19
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -0.78

References

1. Ma Y, Li L, He S, Shang C, Sun Y, Liu N, Meek TD, Wang Y, Shang L..  (2019)  Application of Dually Activated Michael Acceptor to the Rational Design of Reversible Covalent Inhibitor for Enterovirus 71 3C Protease.,  62  (13): [PMID:31184893] [10.1021/acs.jmedchem.9b00387]

Source