4-(4-bromophenyl)-5-methylene-1-phenyl-1H-pyrrol-2(5H)-one

ID: ALA4551820

PubChem CID: 155555855

Max Phase: Preclinical

Molecular Formula: C17H12BrNO

Molecular Weight: 326.19

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(c2ccc(Br)cc2)=CC(=O)N1c1ccccc1

Standard InChI:  InChI=1S/C17H12BrNO/c1-12-16(13-7-9-14(18)10-8-13)11-17(20)19(12)15-5-3-2-4-6-15/h2-11H,1H2

Standard InChI Key:  DCTKMECWXQWNAO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    4.2496   -0.9781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2485   -1.7977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9565   -2.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6662   -1.7972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6634   -0.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9547   -0.5693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5405   -2.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7987   -1.8719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2514   -2.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6595   -3.1868    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4589   -3.0174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4388   -2.3927    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0673   -3.5630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3306   -3.9325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5166   -4.0161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1836   -4.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6636   -5.4240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4804   -5.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8095   -4.5904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3695   -0.5633    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  2  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
  9 12  2  0
 11 13  2  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 10 14  1  0
  5 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551820

    ---

Associated Targets(non-human)

Pseudomonas aeruginosa (123386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 326.19Molecular Weight (Monoisotopic): 325.0102AlogP: 4.39#Rotatable Bonds: 2
Polar Surface Area: 20.31Molecular Species: NEUTRALHBA: 1HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 2Heavy Atoms: 20QED Weighted: 0.80Np Likeness Score: -0.32

References

1. Almohaywi B, Yu TT, Iskander G, Chan DSH, Ho KKK, Rice S, Black DS, Griffith R, Kumar N..  (2019)  Dihydropyrrolones as bacterial quorum sensing inhibitors.,  29  (9): [PMID:30857746] [10.1016/j.bmcl.2019.03.004]

Source