2-(9H-Carbazol-9-yl)-N-ethyl-N-(4-fluorobenzyl)acetamide

ID: ALA4551915

PubChem CID: 155555765

Max Phase: Preclinical

Molecular Formula: C23H21FN2O

Molecular Weight: 360.43

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN(Cc1ccc(F)cc1)C(=O)Cn1c2ccccc2c2ccccc21

Standard InChI:  InChI=1S/C23H21FN2O/c1-2-25(15-17-11-13-18(24)14-12-17)23(27)16-26-21-9-5-3-7-19(21)20-8-4-6-10-22(20)26/h3-14H,2,15-16H2,1H3

Standard InChI Key:  SENZHCJSQXTVHU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   14.2141  -25.3288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8014  -26.5918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5516  -25.8119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7524  -25.6418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2022  -26.2505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4567  -27.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2553  -27.1986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8771  -25.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6209  -26.5892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1669  -27.2003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9692  -27.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2226  -26.2517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6749  -25.6440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2124  -24.5075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9192  -24.0932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9175  -23.2719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.6319  -24.5045    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.6284  -22.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2089  -22.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2071  -22.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3411  -23.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3387  -24.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0506  -24.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7625  -24.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7581  -23.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0457  -22.8556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4758  -24.4947    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  9  1  0
  8  1  1  0
  1  3  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  1 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  2  0
 16 18  1  0
 16 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 24 27  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4551915

    ---

Associated Targets(Human)

TSPO Tchem Translocator protein (484 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 360.43Molecular Weight (Monoisotopic): 360.1638AlogP: 4.98#Rotatable Bonds: 5
Polar Surface Area: 25.24Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.66CX LogD: 4.66
Aromatic Rings: 4Heavy Atoms: 27QED Weighted: 0.49Np Likeness Score: -1.53

References

1. Cheng HWA, Sokias R, Werry EL, Ittner LM, Reekie TA, Du J, Gao Q, Hibbs DE, Kassiou M..  (2019)  First Nondiscriminating Translocator Protein Ligands Produced from a Carbazole Scaffold.,  62  (17): [PMID:31419132] [10.1021/acs.jmedchem.9b00980]

Source