NA

ID: ALA4552089

PubChem CID: 137132615

Max Phase: Preclinical

Molecular Formula: C20H23N9O13P2

Molecular Weight: 659.40

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@@H]3[C@H](O)[C@@H](COP(=O)(O)O[C@H]2[C@H]1O)O[C@H]3n1cnc2c(=O)[nH]cnc21

Standard InChI:  InChI=1S/C20H23N9O13P2/c21-15-9-16(23-3-22-15)28(5-26-9)19-12(31)13-8(40-19)2-38-44(35,36)42-14-11(30)7(1-37-43(33,34)41-13)39-20(14)29-6-27-10-17(29)24-4-25-18(10)32/h3-8,11-14,19-20,30-31H,1-2H2,(H,33,34)(H,35,36)(H2,21,22,23)(H,24,25,32)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1

Standard InChI Key:  KHPSNOLQNDOWJF-XPWFQUROSA-N

Molfile:  

 
     RDKit          2D

 44 50  0  0  0  0  0  0  0  0999 V2000
    8.1949   -6.2467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1949   -7.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9114   -7.4821    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9114   -8.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1949   -8.7223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4783   -8.3089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6951   -8.5627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4818   -9.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7558   -9.6575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7558  -10.4817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1721  -11.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3751  -10.8479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7912  -11.4317    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    3.7912  -10.6097    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9205  -12.5771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4726  -13.2300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0022  -13.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1800  -13.9076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5018  -14.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2886  -15.3605    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5628  -15.6582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7807  -15.2828    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907  -15.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0907  -16.5531    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750  -16.9262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8750  -17.7525    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5628  -16.4779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3592  -16.6953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8103  -16.0049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2632  -14.2937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2632  -13.4677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9795  -13.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6914  -13.4677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0224  -11.6775    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    8.2312  -12.4745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8003  -11.7856    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8254   -9.9997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0033   -9.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5524  -10.6947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7656  -11.4918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9942  -11.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2118   -7.8953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6952   -7.2279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4783   -7.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  6  7  1  0
  8  7  1  1
  9  8  1  0
 10  9  1  0
 10 11  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 16 15  1  6
 17 16  1  0
 17 18  1  6
 19 17  1  0
 19 20  1  1
 21 20  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 27 25  1  0
 27 21  2  0
 28 27  1  0
 29 28  2  0
 29 20  1  0
 30 19  1  0
 31 30  1  0
 16 31  1  0
 31 32  1  1
 32 33  1  0
 34 33  1  0
 34 35  1  0
 34 36  2  0
 37 34  1  0
 38 37  1  6
 38  8  1  0
 38 39  1  0
 39 10  1  0
 39 40  1  6
 13 41  2  0
  7 42  1  0
 42 43  2  0
 44 43  1  0
 44  6  2  0
 44  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4552089

    ---
  2. Alternative Forms:

    ALA4552089

    ---

Associated Targets(Human)

STING1 Tchem Stimulator of interferon genes protein (1885 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Monocyte (474 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Nuclease P1 (7 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Sting1 Stimulator of interferon genes protein (255 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 659.40Molecular Weight (Monoisotopic): 659.0891AlogP: -1.92#Rotatable Bonds: 2
Polar Surface Area: 303.63Molecular Species: ACIDHBA: 19HBD: 6
#RO5 Violations: 3HBA (Lipinski): 22HBD (Lipinski): 7#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.52CX Basic pKa: 4.92CX LogP: -5.11CX LogD: -7.79
Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: 0.68

References

1. Novotná B, Vaneková L, Zavřel M, Buděšínský M, Dejmek M, Smola M, Gutten O, Tehrani ZA, Pimková Polidarová M, Brázdová A, Liboska R, Štěpánek I, Vavřina Z, Jandušík T, Nencka R, Rulíšek L, Bouřa E, Brynda J, Páv O, Birkuš G..  (2019)  Enzymatic Preparation of 2'-5',3'-5'-Cyclic Dinucleotides, Their Binding Properties to Stimulator of Interferon Genes Adaptor Protein, and Structure/Activity Correlations.,  62  (23): [PMID:31715099] [10.1021/acs.jmedchem.9b01062]
2. Lioux T,Mauny MA,Lamoureux A,Bascoul N,Hays M,Vernejoul F,Baudru AS,Boularan C,Lopes-Vicente J,Qushair G,Tiraby G.  (2016)  Design, Synthesis, and Biological Evaluation of Novel Cyclic Adenosine-Inosine Monophosphate (cAIMP) Analogs That Activate Stimulator of Interferon Genes (STING).,  59  (22.0): [PMID:27783523] [10.1021/acs.jmedchem.6b01300]

Source