The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
NA ID: ALA4552089
PubChem CID: 137132615
Max Phase: Preclinical
Molecular Formula: C20H23N9O13P2
Molecular Weight: 659.40
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@@H]3[C@H](O)[C@@H](COP(=O)(O)O[C@H]2[C@H]1O)O[C@H]3n1cnc2c(=O)[nH]cnc21
Standard InChI: InChI=1S/C20H23N9O13P2/c21-15-9-16(23-3-22-15)28(5-26-9)19-12(31)13-8(40-19)2-38-44(35,36)42-14-11(30)7(1-37-43(33,34)41-13)39-20(14)29-6-27-10-17(29)24-4-25-18(10)32/h3-8,11-14,19-20,30-31H,1-2H2,(H,33,34)(H,35,36)(H2,21,22,23)(H,24,25,32)/t7-,8-,11-,12-,13-,14-,19-,20-/m1/s1
Standard InChI Key: KHPSNOLQNDOWJF-XPWFQUROSA-N
Molfile:
RDKit 2D
44 50 0 0 0 0 0 0 0 0999 V2000
8.1949 -6.2467 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1949 -7.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9114 -7.4821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9114 -8.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1949 -8.7223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4783 -8.3089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6951 -8.5627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4818 -9.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7558 -9.6575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7558 -10.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1721 -11.0655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3751 -10.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7912 -11.4317 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.7912 -10.6097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9205 -12.5771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4726 -13.2300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0022 -13.9076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1800 -13.9076 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5018 -14.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2886 -15.3605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5628 -15.6582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7807 -15.2828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -15.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0907 -16.5531 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -16.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8750 -17.7525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5628 -16.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3592 -16.6953 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8103 -16.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2632 -14.2937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2632 -13.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9795 -13.0590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6914 -13.4677 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0224 -11.6775 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
8.2312 -12.4745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8003 -11.7856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8254 -9.9997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0033 -9.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5524 -10.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7656 -11.4918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9942 -11.2185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2118 -7.8953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6952 -7.2279 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4783 -7.4821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
6 7 1 0
8 7 1 1
9 8 1 0
10 9 1 0
10 11 1 1
11 12 1 0
12 13 1 0
13 14 1 0
13 15 1 0
16 15 1 6
17 16 1 0
17 18 1 6
19 17 1 0
19 20 1 1
21 20 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
27 25 1 0
27 21 2 0
28 27 1 0
29 28 2 0
29 20 1 0
30 19 1 0
31 30 1 0
16 31 1 0
31 32 1 1
32 33 1 0
34 33 1 0
34 35 1 0
34 36 2 0
37 34 1 0
38 37 1 6
38 8 1 0
38 39 1 0
39 10 1 0
39 40 1 6
13 41 2 0
7 42 1 0
42 43 2 0
44 43 1 0
44 6 2 0
44 2 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 659.40Molecular Weight (Monoisotopic): 659.0891AlogP: -1.92#Rotatable Bonds: 2Polar Surface Area: 303.63Molecular Species: ACIDHBA: 19HBD: 6#RO5 Violations: 3HBA (Lipinski): 22HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.52CX Basic pKa: 4.92CX LogP: -5.11CX LogD: -7.79Aromatic Rings: 4Heavy Atoms: 44QED Weighted: 0.13Np Likeness Score: 0.68
References 1. Novotná B, Vaneková L, Zavřel M, Buděšínský M, Dejmek M, Smola M, Gutten O, Tehrani ZA, Pimková Polidarová M, Brázdová A, Liboska R, Štěpánek I, Vavřina Z, Jandušík T, Nencka R, Rulíšek L, Bouřa E, Brynda J, Páv O, Birkuš G.. (2019) Enzymatic Preparation of 2'-5',3'-5'-Cyclic Dinucleotides, Their Binding Properties to Stimulator of Interferon Genes Adaptor Protein, and Structure/Activity Correlations., 62 (23): [PMID:31715099 ] [10.1021/acs.jmedchem.9b01062 ] 2. Lioux T,Mauny MA,Lamoureux A,Bascoul N,Hays M,Vernejoul F,Baudru AS,Boularan C,Lopes-Vicente J,Qushair G,Tiraby G. (2016) Design, Synthesis, and Biological Evaluation of Novel Cyclic Adenosine-Inosine Monophosphate (cAIMP) Analogs That Activate Stimulator of Interferon Genes (STING)., 59 (22.0): [PMID:27783523 ] [10.1021/acs.jmedchem.6b01300 ]