The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-naphthylmethyl)-3-(4-nonylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptan-2-amine ID: ALA4552145
PubChem CID: 155555414
Max Phase: Preclinical
Molecular Formula: C32H42N2O2S
Molecular Weight: 518.77
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCc1ccc(S(=O)(=O)C2C3CCC(N3)C2NCc2ccc3ccccc3c2)cc1
Standard InChI: InChI=1S/C32H42N2O2S/c1-2-3-4-5-6-7-8-11-24-15-18-28(19-16-24)37(35,36)32-30-21-20-29(34-30)31(32)33-23-25-14-17-26-12-9-10-13-27(26)22-25/h9-10,12-19,22,29-34H,2-8,11,20-21,23H2,1H3
Standard InChI Key: MQFFTKLJAPGZTH-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
10.0134 -13.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7793 -13.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7793 -11.9623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2187 -12.6779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4256 -12.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0160 -12.8954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5765 -13.6113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7900 -14.4069 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5856 -14.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7991 -15.4160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5991 -15.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8104 -16.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2278 -17.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4331 -16.7995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2132 -16.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4430 -17.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2402 -18.0205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8208 -17.4361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6069 -16.6398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8118 -12.6821 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.0251 -11.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4430 -11.2995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6565 -10.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4526 -10.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0366 -10.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8258 -11.6717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6703 -9.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0837 -8.9117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2971 -8.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7147 -7.5295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9282 -6.7338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3416 -6.1472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5593 -5.3514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9727 -4.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1861 -3.9692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0258 -13.4799 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.6114 -12.8968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 0
5 4 1 0
1 5 1 0
6 4 1 0
7 6 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
13 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
12 19 1 0
6 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
20 36 2 0
20 37 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.77Molecular Weight (Monoisotopic): 518.2967AlogP: 6.57#Rotatable Bonds: 13Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 8.08CX LogP: 7.65CX LogD: 6.89Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -0.06
References 1. Bobrovs R, Jaudzems K, Jirgensons A.. (2019) Exploiting Structural Dynamics To Design Open-Flap Inhibitors of Malarial Aspartic Proteases., 62 (20): [PMID:31062983 ] [10.1021/acs.jmedchem.9b00184 ]