N-(2-naphthylmethyl)-3-(4-nonylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptan-2-amine

ID: ALA4552145

PubChem CID: 155555414

Max Phase: Preclinical

Molecular Formula: C32H42N2O2S

Molecular Weight: 518.77

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCc1ccc(S(=O)(=O)C2C3CCC(N3)C2NCc2ccc3ccccc3c2)cc1

Standard InChI:  InChI=1S/C32H42N2O2S/c1-2-3-4-5-6-7-8-11-24-15-18-28(19-16-24)37(35,36)32-30-21-20-29(34-30)31(32)33-23-25-14-17-26-12-9-10-13-27(26)22-25/h9-10,12-19,22,29-34H,2-8,11,20-21,23H2,1H3

Standard InChI Key:  MQFFTKLJAPGZTH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   10.0134  -13.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7793  -13.3893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7793  -11.9623    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2187  -12.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4256  -12.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0160  -12.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5765  -13.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7900  -14.4069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.5856  -14.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7991  -15.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5991  -15.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8104  -16.4266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2278  -17.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4331  -16.7995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2132  -16.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4430  -17.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2402  -18.0205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8208  -17.4361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6069  -16.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8118  -12.6821    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.0251  -11.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4430  -11.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6565  -10.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4526  -10.2941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0366  -10.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8258  -11.6717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6703   -9.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0837   -8.9117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2971   -8.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7147   -7.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9282   -6.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3416   -6.1472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5593   -5.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9727   -4.7649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1861   -3.9692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0258  -13.4799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6114  -12.8968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  5  4  1  0
  1  5  1  0
  6  4  1  0
  7  6  1  0
  2  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 13 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 12 19  1  0
  6 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 20 36  2  0
 20 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4552145

    ---

Associated Targets(non-human)

PMII Plasmepsin 2 (774 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Plasmepsin 4 (112 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.77Molecular Weight (Monoisotopic): 518.2967AlogP: 6.57#Rotatable Bonds: 13
Polar Surface Area: 58.20Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 8.08CX LogP: 7.65CX LogD: 6.89
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.25Np Likeness Score: -0.06

References

1. Bobrovs R, Jaudzems K, Jirgensons A..  (2019)  Exploiting Structural Dynamics To Design Open-Flap Inhibitors of Malarial Aspartic Proteases.,  62  (20): [PMID:31062983] [10.1021/acs.jmedchem.9b00184]

Source